Chemistry MC
What is the pH of a solution whose hydronium ion concentration is 5.03E-1 M?
A 0.298
Standard temperature and pressure for a gas is
A 0°C and 1atm
What is the pH of a 0.00162 M NaOH solution?
A 11.210
For the reaction represented by the equation 2H2 + O2 -> 2H2O, how many moles of water can be produced from 6.0 mol of oxygen?
A 12 mol
What is the pH of 0.027 M KOH solution?
A 12.43
Calculate the approximate volume of a 0.600 mol sample of gas at 15.0°C and a pressure of 1.10 atm.
A 12.9 L
A sample of a gas has a volume of 150 mL when its pressure is 0.947 atm. What will the volume of the gas be at a pressure of 0.987 atm, if the temperature remains constant?
A 144 mL
A sample of a gas occupies a volume of 752 mL at 25°C. What volume will the gas occupy if the temperature increases to 50°C, if the pressure remains constant?
A 1500 mL
In the reaction Ca + Cl2 -> CaCl2, what is the mole ratio of chlorine to calcium chloride?
A 1:1
The pH of a solution is 9.0. What is its H3O+ concentration?
A 1E-9
(look at study guide for chart) For the reaction represented by the equation 3Fe + 4H2O -> Fe3O4 + 4H2, how many moles of iron(III) oxide are produced from 500. g of iron in an excess of H2O?
A 2.98 mol
An NaOH solution contains 1.90 mol of NaOH, and its concentration is 0.555 M. What is its volume?
A 3.42 L
What is the pH of a 1E-4 M HCl solution?
A 4
A pressure of 700. kPa is equal to ________mm Hg.
A 5250 mm Hg
(look at study guide for chart) For the reaction represented by the equation CH4 + 2O2 -> CO2 + 2H2O, how many moles of carbon dioxide are produced from the combustion of 100. g of methane?
A 6.23 mol
For the reaction CH4 + 2O2 -> CO2 + 2H2O, calculate the percentage yield of carbon dioxide if 1000. g of methane react with excess oxygen to produce 2300. g of carbon dioxide
A 83.88%
For the reaction Cl2 + 2KBr -> 2KCl + Br2, calculate the percentage yield if 200. g of chlorine react with excess potassium bromide to produce 410. g of bromine.
A 90.9%
A water solution whose pH is 4
A is always acidic
The substance that restricts the participation of other reactants in a chemical formula is known as the
A limiting reactant
What is the ratio of the actual yield to the theoretical yield, multiplied by 100%?
A percentage yield
A sample of a gas has a pressure of 3.00 atm at 25°C. What would the gas pressure be at 52°C, if the volume remains constant?
B 3.27 atm
If H3O+ = 8.26E-5 M, what is the pH of the solution?
B 4.083
A 1.00 L sample of a gas has a mass of 1.92 g at STP. What is the molar mass of the gas?
B 43.0g/mol
The volume of a gas is 5.0L when the temperature is 5.0°C. If the temperature is increased to 10.0°C without changing the pressure, what is the new volume?
B 5.1 L
What is the hydronium ion concentration of a solution whose pH is 4.12?
B 7.6E-5
What is the acid-ionization constant, Ka, for the ionization of acetic acid, shown in the reaction CH3COOH+ H2O -> H3O+ + CH3COOH-?
B [H3O+][CH3COO-]/[CH3COOH]
What is the pH of a solution whose hydronium ion concentration is 5.03E-1 M?
C 0.2984
If H3O+ = 1.7E-3, what is the pH of the solution?
C 1.81
What is the OH- concentration of a solution whose pH is 12.40?
C 2.5E-2M
(look at study guide for chart) For the reaction represented by the equation 2Na + Cl2 -> 2NaCl, how many grams of chlorine gas are required to react completely with 2.00 mol of sodium?
C 70.9 g
The average atmospheric pressure in Denver is 0.830 atm. What is this pressure in kPa?
C 84.1 kPa
For the reaction 2Na + 2H2O -> 2NaOH + H2, calculate the percentage yield if 80. g of water react with excess sodium to produce 4.14 g of hydrogen.
C 92%
(look at study guide for chart) How many moles of HCl are present in 0.70 L of a 0.33 M HCl solution?
D 0.23 mol
The pH of a solution is 10. What is its OH- concentration?
D 1.00E-4 M
The pH of a solution is 10.00. What is its OH- concentration?
D 1.0E-4
For the reaction represented by the equation Cl2 + 2KBr -> 2KCl + Br2, how many grams of potassium chloride can be produced from 300. g each of chlorine and potassium bromide?
D 10.0 L
Calculate the approximate volume of a 0.600 mol sample of gas at 15.0°C and a pressure of 1.10 atm.
D 12.9 L
The volume of a gas collected when the temperature is 11.0 degrees C and the pressure is 710 mm Hg measures 14.8 mL. What is the calculated volume of the gas at 20.0 degrees C and 740 mm Hg
D 14.6 mL
Calculate the approximate temperature of a 0.50 mol sample of gas at 750 mm Hg and a volume of 12 L.
D 15°C
A 1.00 L sample of a gas has a mass of 1.25 g at STP. What is the mass of 1.00 mol of this gas?
D 28.0 g
Chlorine is produced by the reaction 2HCl -> H2 + Cl2 How many grams of HCl (36.5 g/mol) must be used to produce 10.0 L of chlorine at STP?
D 32.6 g
(look at study guide for chart) For the reaction represented by the equation SO3 + H2O -> H2SO4, how many grams of sulfur trioxide are required to produce 4.00 mol of sulfuric acid in an excess of water?
D 320. g
For the reaction represented by the equation 2Na + 2H2O -> 2NaOH + H2, how many grams of hydrogen are produced if 120. g of sodium and 80. g of water are available?
D 4.5 g
(look at study guide for chart) For the reaction represented by the equation 2Na + Cl2 -> 2NaCl, how many grams of chlorine gas are required to react completely with 2.00 mol of sodium?
D 593 g
What is the pH of a neutral solution at 25°C?
D 7
The volume of a gas is 93 mL when the temperature is 91°C. If the temperature is reduced to 0°C without changing the pressure, what is the new volume of the gas?
D 70. mL
For the reaction 2Na + Cl2 -> 2NaCl, calculate the percentage yield if 200. g of chlorine react with excess sodium to produce 240. g of sodium chloride.
D 72.8%
What is the pH of a 1E-5M KOH solution?
D 9
For the reaction SO3 + H2O -> H2SO4, calculate the percentage yield if 500 g of sulfur trioxide react with excess water to produce 575 g of sulfuric acid.
D 93.9%
The substance not completely used up in a chemical reaction is known as the
D excess reactant
