Troy Chemistry Final Prep
True or False: All three of the most common sugars are monosaccharides.
False
True or False: Another term for a combustion reaction is decomposition.
False
True or False: Given the statement "20.0 g of methane is burned in excess oxygen," is it obvious that oxygen is the limiting reagent.
False
True or False: It is possible to use mole ratios when the chemical equation has not been balanced.
False
True or False: The radiocarbon dating method can not be used to determine the age of an object that is older than 4000 years.
False
Which functional group contains a nitrogen atom? a. ester b. amine c. carboxylic acid d. ketone
b. amine
True or False: A synthesis reaction occurs when two or more reactants combine to form a single product.
True
True or False: Even though the equilibrium position can shift, the value of the equilibrium constant does not change.
True
True or False: Given the statement "the metal is heated in the presence of excess hydrogen," is it obvious that the metal is the limiting reagent.
True
True or False: Ionizing radiation can cause cancer.
True
True or False: Sucrose is a disaccharide
True
True or False: Sucrose is made up of glucose units only.
True
True or False: The following reaction is an oxidation-reduction reaction: 2Na(s) + Cl2(ℓ) → 2NaCl(s)
True
Which of the following does not contain oxygen? a. esters b. alkanes c. ketones d. alcohols
b. alkanes
What is the oxidation number of sulfur in the following molecule? SO22− a. +2 b. +3 c. +4 d. +5
a. +2
The complementary base sequence in the second strand of DNA for the base sequence C-C-G-A-T-T would be ____________________. a. -G-G-C-T-A-A- b. -C-C-G-A-T-T- c. -A-A-T-C-G-G- d. -G-G-C-U-A-A-
a. -G-G-C-T-A-A-
The following reaction is at equilibrium: CH4 + 2Cl2⇄CH2Cl2 + 2HCl If [CH4] is 0.250 M, [Cl2] is 0.150 M, and [CH2Cl2] is 0.175 M at equilibrium, what is [HCl] at equilibrium if the Keq is 2.30? a. 0.272 M b. 0.027 M c. 2.72 M d. 2.30 M
a. 0.272 M
The half-life of bromine-74 is 25 min. How much of a 4.0 mg sample is still active after 75 min? a. 0.50 mg b. 1.0 mg c. 2.0 mg d. 0.25 mg
a. 0.50 mg
Determine the equilibrium concentrations for [HNC] for this chemical reaction with the given Keq. HCN(g)⇄HNC(g) Keq=4.50 2.00 M a. 1.64 M b. 0.364 M c. 2.00 M d. 4.50 M
a. 1.64 M
The half-life of carbon-14 is 5730 years. What is the approximate age of a fossil with a carbon-14 ratio to carbon 1/32 that of a living organism of the same species? a. 28650 years b. 5730 years c. 11460 years d. 22920 years
a. 28650 years
What is the complete ionic equation when solutions of sodium sulfite and calcium chloride are mixed? a. 2H+(aq) + (SO3)-2(aq) + Ca+2(aq) + 2Cl-(aq) ---> CaSO3(s) + 2Na+(aq) + 2Cl-(aq) b. Ca+2(aq) + SO3-2(aq) ---> CaSO3(s) c. H+(aq) + Cl-(aq) ----> HCl(s) d. None of the above
a. 2H+(aq) + (SO3)-2(aq) + Ca+2(aq) + 2Cl-(aq) ---> CaSO3(s) + 2Na+(aq) + 2Cl-(aq)
How many total atoms are in the cholesterol molecule? a. 74 b. 45 c. 27 d. It varies between molecules.
a. 74
A compound containing only carbon and hydrogen and which has only single bonds between atoms is classified as an a. Alkane b. Alkene c. Alkyne d. Aromatic
a. Alkane
Which characteristic functional group is present in almost all of the monomers that participate in addition polymerization? a. C=C b. C—Cl c. OH d. CHO
a. C=C
Which of the following is an oxidation? a. Fe ----> Fe2+ + 2e- b. Cl2 + 2e- ----> 2Cl- c. Fe3+ + 3e- ----> Fe d. Fe3+ + e- ----> Fe2+
a. Fe ----> Fe2+ + 2e-
Which of the following is always a product of a combustion reaction? a. H2O b. O2 c. H2 d. N2
a. H2O
What is being reduced in the following equation? 2KrF2 + 2H2O → 2Kr + 4HF + O2 a. Kr b. F c. H d. O
a. Kr
The oxidizing agent used in a standard "alkaline" battery is _______. a. MnO2 b. PbSO4 c. MgO d. NH3
a. MnO2
What is being oxidized in the following equation? 2NO + Cl2 → 2NOCl a. N b. O c. Cl
a. N
In following reaction, which of the following is being oxidized (lost electrons)? 2CaF2 + 2H2O → 2Ca + 4HF + O2 a. O b. F c. H d. Ca
a. O
Which of the following is NOT included in the equilibrium expression for a given reaction? a. Solids b. Reactants c. Products d. The Power of the Coefficient
a. Solids
Given this equilibrium, predict the direction of shift if the temperature of the reaction is decreased. H2(g) + I2(s) + 53 kJ⇄2HI(g) a. The equilibrium will shift toward the reactants. b. The equilibrium will shift towards the products. c. There will not any change to the equilibrium.
a. The equilibrium will shift toward the reactants.
Given this equilibrium, predict the direction of shift if CO is added to the reaction. CO2(g) + C(s) + 171 kJ⇄2CO(g) a. The equilibrium will shift towards reactants. b. The equilibrium will shift towards products. c. There will be no change in the equilibrium reaction.
a. The equilibrium will shift towards reactants.
The process of melting ice is an endothermic process that can be modeled using the chemical equation below: H2O(s) + heat <---> H2O(l) What would be the effect of removing heat when this process is at equlibrium? a. The reaction will start making more ice. b. The reaction will start making more liquid water. c. The reaction will start making more heat. d. No change will occur in the equilibrium.
a. The reaction will start making more ice.
Which atom can undergo fission by thermal neutrons? a. U-235 b. U-238 c. I-131 d. H-3
a. U-235
Use the simple equilibrium below: A<-->B Keq=0.650 Suppose the 1.00 mole of A is introduced into a 1.00 L container. Use the ICE method to determine the concentration of A and B after equilibrium has attained. a. [A]=0.606 M; [B]=0.394 M b. [A]=0.650 M; [B]=0.423 M c. [A]=0.423 M; [B]=0.650 M d. [A]=0.394 M; [B]=0.606 M
a. [A]=0.606 M; [B]=0.394 M
During beta emission... a. a neutron turns into a proton. b. a proton turns into a neutron. c. a proton turns into an electron. d. a proton is emitted from the nucleus.
a. a neutron turns into a proton.
A basic amino acid has a side chain that contains ______. a. an amine group b. a carboxyl group c. a methyl group d. an alcohol group e. a thiol group
a. an amine group
When iron, Fe, is oxidized to form rust it will form a(n) ______. a. cation b. anion c. negative ion d. neutral particle
a. cation
Which of the following would cause Keq for an equilibrium reaction to change? a. changing the temperature b. changing the concentration of a reactant c. changing the concentration of a product d. changing the pressure
a. changing the temperature
The cathode in a voltaic cell is the a. electrode where chemicals are reduced. b. solution where chemicals are reduced. c. solution where chemicals are oxidized. d. electrode where chemicals are oxidized.
a. electrode where chemicals are reduced.
Polymerization is a(n) a. formation of large molecules out of little ones b. analysis of the chemical content of polymers c. formation of small molecules out of large ones d. effective means of producing molecules of intermediate size, but not very large ones
a. formation of large molecules out of little ones
When a sulfur atom is reduced it will _____. a. gain 2e- b. lose 2e- c. lose 1e- d. gain 1e-
a. gain 2e-
When an element is oxidized... a. it loses electrons. b. it gains electrons. c. it gains protons and loses electrons. d. it must combine with oxygen.
a. it loses electrons.
Which elements have the greatest tendency to act as reducing agents? a. metals b. nonmetals c. noble gases d. halogens
a. metals
The small molecules used to synthesize polymers are called a. monomers b. peptides c. macromolecules d. elastomers
a. monomers
The largest source of naturally occurring radiation is _____. a. radon-222 b. uranium-235 c. cosmic rays d. television tubes
a. radon-222
The difference between an addition polymer and a condensation polymer is... a. that in the condensation polymer not all atoms of the monomer are included in the polymer. b. the type of atoms making up the polymer backbone. c. the amount of cross-linking found between polymer chains. d. the type of groups acting as pendant groups on the polymer backbone.
a. that in the condensation polymer not all atoms of the monomer are included in the polymer.
Charge is transported from place to place in a battery by a. the migration of ions b. a cathode c. an external electrical circuit d. an anode
a. the migration of ions
A fatty acid salt can act as a soap to remove grease because a. the nonpolar tails of the salt dissolve in the grease and the polar salt ends dissolve in water. b. the nonpolar tails of the salt cause the salt to float on the surface of the water. c. the polar salt ends dissolve in the grease and the nonpolar tails cause the resulting micelles to float on water. d. the grease molecules form a thin layer around each salt molecule, making them soluble in water. e. the salt molecules combine with grease and either Ca2+ or Mg2+ to form a precipitate.
a. the nonpolar tails of the salt dissolve in the grease and the polar salt ends dissolve in water.
In any balanced chemical equation, the number of each type of atom on both sides of the equation is... a. the same. b. decreased by one. c. increased by one. d. dependent on the temperature.
a. the same.
Oxidation-reduction reactions involve... a. the transfer of electrons. b. the ionization of elements. c. transfer of protons. d. the conversion of one element into another.
a. the transfer of electrons.
Oxidation always occurs: a. with the loss of electrons b. with the gain of electrons c. with the gain of hydrogen d. only for metal atoms and not ions
a. with the loss of electrons
Which of the following equations below represents the balanced redox reactions by the half reaction method for the following reaction? Al2O3 + C → Al + CO2 a. 2Al2O3 + 3C → 4Al + 3CO2 b. Al2O3 + 3C → 4Al + 3CO2 c. 2Al2O3 + C → 4Al + 3CO2 d. 2Al2O3 + 3C → Al + 3CO2
a.2Al2O3 + 3C → 4Al + 3CO2
What is the equilibrium expression for the reaction below: 2CO(g) + O2(g) <---> 2CO2(g) a.K=[CO2]^2/[CO]^2[O2] b. K=[CO2]^2/[CO][O2]^2 c.K=[CO2]/[CO]^2[O2] d.K=[CO2]/[CO^]2[O]
a.K=[CO2]^2/[CO]^2[O2]
The following reaction is at equilibrium: Co(g)+ Cl2(g)⇄CoCl2(g) The equilibrium [Co] and [Cl2] are 0.088 M and 0.103 M, respectively. If the Keq is 0.225, what is the equilibrium [CoCl2]? a. .020 M b. .002 M c. .200 M d. 2.02 M
b. .002 M
How many moles of Al can be produced from 10.87 g of Ag? Al(NO3) 3(s) + 3Ag → Al + 3AgNO3 a. 3.62 moles b. 0.0336 moles c. 32.61 moles d. .336 moles
b. 0.0336 moles
Determine the equilibrium concentration of NO for this chemical reaction with the given Keq. N2O3(g)⇄NO(g)+NO2(g) Keq=2.50 0.0663M a. 0.0663 M b. 0.0646 M c. 0.0017 M d. 0.646 M
b. 0.0646 M
Which of the following correctly gives the best coefficients for the reaction below? N2H4 + H2O2 ----> N2 + H2O a. 1,1,1,1 b. 1,2,1,4 c. 1,4,1,4 d. 2,4,2,4
b. 1,2,1,4
How many grams of Sodium-24 will remain in a patient after a 12.0 g sample of Sodium-24 decays for 45 hours? Half life of Sodium-24 = 15.0 hours. a. 0.75 g b. 1.5 g c. 3.0 g d. 6.0 g
b. 1.5 g
After 3 half lives have elapsed, the amount of a radioactive sample which has not decayed is... a. 1/4 the original amount. b. 1/8 the original amount. c. 1/16 the original amount. d. 6.25 % of the original amount.
b. 1/8 the original amount.
The current disintegration rate for carbon-14 is 14.0 Bq. A sample of burnt wood discovered in an archeological excavation is found to have a carbon-14 disintegration rate of 3.5 Bq. If the half-life of carbon-14 is 5,730 y, approximately how old is the wood sample? a. 5730 y b. 11,500 y c. 11,460 y d. 2865 y
b. 11,500 y
For the balanced chemical equation: 6H+(aq) + 2MnO4−(aq) + 5H2O2(ℓ) → 2Mn2+(aq) + 5O2(g) + 8H2O(ℓ) how many molecules of H2O are produced when 100 molecules of H2O2 react? a. 8 molecules b. 160 molecules c. 62.5 molecules d. 5 molecules
b. 160 molecules
When the following reaction is correctly balanced, what is the coefficient for hydrogen gas, H2? H2 + ? O2 ----> ? H2O a. 1 b. 2 c. 3 d. 4
b. 2
A worker isolates 2.675 g of SiF4 after reacting 2.339 g of SiO2 with HF. What is the actual yield? SiO2(s) + 4HF(g) → SiF4(g) + 2H2O(ℓ) a. 2.339 grams b. 2.675 grams c. 3.145 grams d. 5.135 grams
b. 2.675 grams
How many moles are represented by 3.11 × 1024 molecules of NO2? a. 3 moles b. 5.164 moles c. 6.023 X 10 23 moles d. 6 moles
b. 5.164 moles
Which of the following represents Avogadro's Number? a. 6.02214076 × 10^24 b. 6.02214076 × 10^23 c. 6.02214076 × 10^22 d. 6.02214076 × 10^21
b. 6.02214076 × 10^23
How many molecules of SO3 are needed to react with 200 molecules of Fe2O3 given this balanced chemical equation? Fe2O3(s) + 3SO3(g) → Fe2(SO4)3 a. 200 molecules b. 600 molecules c. 67 molecules d. 3 molecules
b. 600 molecules
If 88.4 g of CH2S are reacted, what mass of HF is produced? CH2S + 6F2 → CF4 + 2HF + SF6 a. 7.67 grams b. 76.7 grams c. 44.2 grams d. 176.8 grams
b. 76.7 grams
What percentage of our daily radiation exposure is natural? a. 70% b. 82% c. 18% d. 30%
b. 82%
In the following reaction, which is being reduced? 2Na + CaCl2 → 2NaCl + Ca a. Na b. Ca c. Cl
b. Ca
Which is not an addition polymer? a. Teflon b. Dacron c. polyethylene d. Styrofoam
b. Dacron
How would you classify the following reaction? 2H2O---> 2H2 + O2 a. Single Replacement b. Decomposition c. Composition d. Neutralization
b. Decomposition
Which of the following is a reduction? a. Fe ----> Fe2+ + 2e- b. Fe3+ + 3e-----> Fe c. 2Br- ----> Br2 + 2e- d. Al ----> Al3+ + 3e-
b. Fe3+ + 3e-----> Fe
For the following balanced displacement reaction, which of the following compounds would be the precipitate in the reaction? FeCl2(aq) + K2S(aq) ----> 2KCl + FeS a. KCl b. FeS c. K2S d. FeCl2
b. FeS
Write an equation for the half-reaction in which a potassium atom, K, is oxidized. a. K + e- ----> K+ b. K ----> K+ + e- c. K + e- ----> K- d. K- ----> K+ + 2 e-
b. K ----> K+ + e-
What would happen if you added CoCl42- to the following reaction at equilibrium? CoCl42-+ H2O--->CoCl2*6H2O + Cl- a. K would decrease, since there would be more reactants than products. b. K would remain unchanged, since it is a constant. c. The reaction would not shift. d. The reaction would shift towards products.
b. K would remain unchanged, since it is a constant.
"Whenever a stress is applied to a system at equilibrium, the equilibrium shifts in such a way as to undo the effect of the stress imposed". This quote is known as the a. Law of Mass Action b. Le Chatelier's Principle c. Dilution Law d. Rate Law
b. Le Chatelier's Principle
Which of these choices is the correct net ionic equation for the reaction that occurs when a manganese (II) nitrate solution is mixed with a sodium hydroxide solution? a. Mn(NO3)2(aq) + 2 NaOH(aq) ---> 2 NaNO3(aq) + Mn(OH)2(s) b. Mn+2(aq) + OH-(aq) --->Mn(OH)2(s) c. Na+ (aq)+ NO3-(aq) ---->NaNO3(s) d. None of the above
b. Mn+2(aq) + OH-(aq) --->Mn(OH)2(s)
Which of the following are spectator ions for a reaction between solutions of silver nitrate and sodium sulfide are mixed. 2 AgNO3(aq) + Na2S(aq)--->2 NaNO3(aq) + Ag2S(s) a. Ag and NO3 b. Na and NO3 c. Ag and S d. Na and S
b. Na and NO3
Which of these choices is the correct net ionic equation for the reaction that occurs when solutions of Pb(NO3)2 and NH4Cl are mixed? a. Pb(NO3)2 (aq) + 2 NH4Cl (aq) → NH4NO3 (aq) + PbCl2 (s) b. Pb2+(aq) + 2Cl−(aq)→ PbCl2(s) c. NH4+ (aq) + NO3−(aq)→ 2 NH4NO3 (s) d. None of the above
b. Pb2+(aq) + 2Cl−(aq)→ PbCl2(s)
Which of the following units is used to report radiation exposure in humans? a. Rad b. Rem c. Curie d. Joule
b. Rem
A voltaic cell is composed of a copper cathode in a copper sulfate solution and a zinc anode in a zinc sulfate solution. The solutions are connected by a salt bridge that contains sodium nitrate, NaNO3. Which of the following occurs after the electrodes are connected by a conducting wire? (Hint: zinc metal is a stronger reducing agent than copper metal) a. The mass of the zinc anode gradually increases. b. The mass of the copper cathode gradually increases. c. Electrons flow from the copper electrode to the zinc electrode. d. There is no flow of electrons.
b. The mass of the copper cathode gradually increases.
A DNA template having the base sequence A-G-A-T-G-A would produce a mRNA with a base sequence of ______. a. A-G-A-T-G-A b. U-C-U-A-C-U c. T-C-T-U-C-T d. T-C-T-A-C-A e. A-C-A-U-C-A
b. U-C-U-A-C-U
An organic compound with an OH functional group is a(n) a. ketone b. alcohol c. aldehyde d. ether
b. alcohol
Proteins are composed of... a. nucleotides. b. amino acids. c. monosaccharides. d. fatty acids.
b. amino acids.
What type of particle is emitted when a U-235 decays to Np-235? a. alpha particle b. beta particle c. neutron d. helium nuclei
b. beta particle
An acid can denature a protein by... a. agitating the protein chains. b. disrupting hydrogen bonds between side chains. c. disrupting hydrophobic interactions within a protein chain. d. removing helping molecules such as heme. e. breaking disulfide bridges.
b. disrupting hydrogen bonds between side chains.
The system is balanced in terms of the forward and reverse reactions. a. homogeneous b. equilibrium c. heterogeneous d. nuclear
b. equilibrium
How many valence electrons does carbon have? a. five b. four c. two d. three
b. four
Which of the following is not a definition of reduction? a. gain of electrons b. gain of protons c. gain of hydrogen d. loss of oxygen
b. gain of protons
The polysaccharide that is the major glucose storage material in animals is ____________________. a. amylopectin b. glycogen c. amylose d. cellulose
b. glycogen
Which of the following substances is oxidized in a fuel cell? a. oxygen b. hydrogen c. methane d. lead
b. hydrogen
Use 3H2(g) + N2(g) <----> 2NH3(g) + 92 kj at equilibrium to answer the questions below: If the Nitrogen N2 concentration is increased, the ammonia NH3 concentration will a. decrease b. increase c. remain the same d. shift
b. increase
When a magnesium atom is oxidized it will ______. a. gain 2e- b. lose 2e- c. lose 1e- d. gain 1e-
b. lose 2e-
Which of the following is a disaccharide? a. galactose b. maltose c. glucose d. glycogen
b. maltose
Which component of a nuclear reactor slows the speed of the neutron? a. heat-transfer fluid b. moderator c. uranium fuel d. shield
b. moderator
Phosphorus-30 undergoes a radioactive decay process involving _____ emission to produce silicon-30. 3015P ----> _____ + 3014Si a. alpha-particle b. positron c. gamma-ray d. neutron
b. positron
A chain made of more than 50 amino acids is usually referred to as a(n) ______. a. peptide b. protein c. enzyme d. globulin e. hormone
b. protein
The breakdown of glucose to chemical energy for the cells to do work is an example of ______. a. oxidation b. respiration c. reduction d. anabolism e. mutarotation
b. respiration
The reactions shown below occur only as written. Use this information to determine which of the following substances oxidizes copper metal, 2AgNO3 + Cu ----> 2 Ag + Cu(NO3)2 2 Cr + 3 Cu(NO3)2 ----> 2 Cr(NO3)3 + 3 Cu a. silver metal, Ag b. silver nitrate, AgNO3 c. chromium metal, Cr d. chromium nitrate, Cr(NO3)3
b. silver nitrate, AgNO3
In a condensation polymerization process, what happens to form the polymer chain? a. small molecules may be split out or required depending on whether an ester or an ether linkage is formed b. small molecules such as water are split out and monomers are linked c. small molecules such as water are moved from one position to another d. small molecules such as water are required for the bonding link
b. small molecules such as water are split out and monomers are linked
What other component does nuclear power utilize in order to create electricity? a. Mercury b. Water c. Air d. Iron
b. water
Increasing the distance from the source of radiation a. will not change the amount of radiation received. b. will reduce the amount of radiation received. c. will increase the amount of radiation received. d. will result in the need of a slower speed film.
b. will reduce the amount of radiation received.
Which of the following is the general equilibrium expression for the reaction shown below? A(aq) + 3B(aq) <---> 2C(aq) a. Keq=2[C]/3[B][A] b.Keq=[C]^2/[B]3[A] c. Keq=[C]^3/[B][A]^2 d. Keq=[B]^3[A]/[C]^2
b.Keq=[C]^2/[B]3[A]
What is the oxidation number of Ba in the compound Ba(NO3)2? a. +1 b. -1 c. +2 d. -2
c. +2
What is the voltage when the following reaction is balanced? Li+ + Al → Li + Al3+ a. 2.78 V b. -2.78 V c. -1.39 V d. 1.39 V
c. -1.39 V
How many molecules are present in .250 moles of H2O? a. 3 molecules b. 1.506 * 10^22 c. 1.506 * 10^23 d. 1 molecule
c. 1.506 * 10^23
The discovery of the phenomenon of radioactivity dates back to the decade _____. a. 1810 - 1820 b. 1850 - 1860 c. 1890 - 1900 d. 1930 - 1940
c. 1890 - 1900
An oxidation-reduction reaction can be separated into ______ half reactions showing the transfer of electrons. A) one half reaction B) two half reactions C) three half reactions D) four half reactions a. 4 b. 1 c. 2 d. 3
c. 2
Which of the following is a conversion factors that can be constructed from the balanced chemical reaction 2H2(g) + O2(g) → 2H2O(ℓ)? a. 1 molecules H2/2 molecules H2O b.1 molecules H2/1 molecules O2 c. 2 molecules H2/1 molecule O2 d. 2 molecules H2/2 molecule O2
c. 2 molecules H2/1 molecule O2
Rubbing alcohol is: a. ethanol, CH3CH2OH b. l-propanol, CH3CH2CH2OH c. 2-propanol, CH3CHOHCH3 d. methanol, CH3OH
c. 2-propanol, CH3CHOHCH3
Which of the following gives the balanced equation for this reaction? K3PO4 + Ca(NO3)2 ----> Ca3(PO4)2 + KNO3 a. K3PO4 + Ca(NO3)2 -----> Ca3(PO4)2 + 3KNO3 b. 2K3PO4 + Ca(NO3)2 -----> Ca3(PO4)2 + 6KNO3 c. 2K3PO4 + 3Ca(NO3)2 -----> Ca3(PO4)2 + 6KNO3 d. K3PO4 + Ca(NO3)2 -----> Ca3(PO4)2 + KNO3
c. 2K3PO4 + 3Ca(NO3)2 -----> Ca3(PO4)2 + 6KNO3
The half life of carbon-14 is a. 6745 y b. 7000 y c. 5730 y d. 4000 y
c. 5730 y
What mass of NaHCO3 is needed to produce 4.659 mol of H2O? 2NaHCO3(s) → Na2CO3(s) + H2O(ℓ) + CO2(g) a. 2.33 grams b. 9.32 grams c. 782.78 grams d. 84.01 grams
c. 782.78 grams
A chemist combusts a 3.009 g sample of C5H12 and obtains 3.774 g of H2O. What is the percent yield? C5H12(ℓ) + 8O2(g) → 5CO2 + 6H2O(ℓ) a. 10.5 % b. 95.1 % c. 83.7 % d. 99.9 %
c. 83.7 %
When nuclear radiations pass through, gas ionization is produced. This is the principle of which of the following detectors? a. Proportional counter b. Flow Counter c. Geiger Counter d. Scintillation counter
c. Geiger Counter
Compounds with the same number and kinds of atoms but with different structures are known as a. Compounds b. Elements c. Isomers d. Liquids
c. Isomers
How would you classify the following reaction? HCl + KOH ----> KCl + H20 a. Single Replacement Reaction b. Double Replacement Reaction c. Neutralization Reaction d. Combustion Reaction
c. Neutralization Reaction
What is the name of the compound with a formula CH3CH2CH3? a. Ethane b. Butane c. Propane d. Methane
c. Propane
What is being oxidized in the following equation? 2Rb + MgCl2 → 2RbCl + Mg a. Cl b. Mg c. Rb
c. Rb
Which of the following is a possible response to a stress to a chemical system? a. The reaction rate of both the forward and reverse reactions increases. b. The reverse reaction stops while the forward reaction continues. c. The reverse reaction is favored. d. The reaction stops.
c. The reverse reaction is favored.
Which of the following is the equilibrium expression for the reaction below? 2NaHCO3(s) <--->Na2CO3(s) + H2O(g) + CO2(g). a. [Na2CO3][H2O][CO2]/[NaHCO3]^2 b. [NaHCO3]^2/[Na2CO3][H2O][CO2] c. [H2O][CO2] d. [CO2]
c. [H2O][CO2]
Which is true about fusion? a. very high temperatures are required b. produces fewer radioactive byproducts c. all statements are true d. occurs in a plasma of charged particles
c. all statements are true
The nuclear reaction shown below is an example of what type of process? 22490Th ----> 22088Rn + 42He a. fusion b. translation c. alpha emission d. beta emission
c. alpha emission
Indicate the missing words in the following statement : "For an ordinary chemical reaction the mass of the products is _____ the mass of the reactants." a. always less than b. usually more than c. always equal to d. usually less than
c. always equal to
The most unique property of carbon is its ability to a. bond to oxygen b. bond to nitrogen c. bond to itself to form long chains. d. form eight bonds
c. bond to itself to form long chains.
Nuclear processes differ from chemical processes in that nuclear processes... a. are never spontaneous. b. produce smaller amounts of energy. c. cause some atoms to change their identities. d. always require 2 reactants.
c. cause some atoms to change their identities.
Carbon atoms always form _____ covalent bonds. a. two b. three c. four d. five
c. four
The most penetrating form of radiation is _____. a. alpha particles b. beta particles c. gamma rays d. protons
c. gamma rays
Both starch and cellulose are composed exclusively of what monosaccaride? a. fructose b. galactose c. glucose d. maltose
c. glucose
What is the "stable" nucleus produced at the end of the decay steps in the uranium decay series? a. radon b. thorium c. lead d. uranium
c. lead
A characteristic of fatty acids is that they possess... a. an aromatic portion. b. an end to the molecule that contains an aldehyde group. c. long chains of carbons. d. an end to the molecule opposite the carboxyl end that contains a hydroxy group.
c. long chains of carbons.
The simplest alkane is a. hexane b. ethane c. methane d. propane
c. methane
Which elements have the greatest tendency to behave as oxidizing agents? a. metals b. transition elements c. nonmetals d. Group 2 elements
c. nonmetals
When chlorine reacts with something else and forms an ion, chlorine is acting as a(n) ______. a. cation b. atom that loses electrons c. oxidizing agent d. reducing agent
c. oxidizing agent
Which of the following is an example of an addition polymer? a. starch b. nylon c. polyethylene d. sugar
c. polyethylene
Carbohydrates which are polymers of many monosaccharide units are called ____________________. a. monosaccharides b. sugars c. polysaccharides d. disaccharides
c. polysaccharides
Which of the following monomers contain a benzene ring (phenyl group) in the molecular structure? a. ethylene b. acrylonitrile c. styrene d. vinyl chloride
c. styrene
Carbon is almost always a. monovalent b. trivalent c. tetravalent. d. divalent
c. tetravalent.
The actual effects of radioactivity and radiation exposure on a person's health are affected by the following: a. the type of skin b. the time of year c. the length of the exposure d. the time of day
c. the length of the exposure
As fatty acids increase in number of carbons, a. there are fewer double bonds. b. the melting point goes down. c. the melting point goes up. d. the number of unsaturated double bonds goes up.
c. the melting point goes up.
Which of the following liquids should be most soluble in water? a. CH3CH2CH2CH2OH b. CH3CH2CH2CH2CH2CH3 c. CH3OCH3 d. CH3OH
d. CH3OH
How does the decay rate of an isotope relate to its half-life? a. the more rapid the decay rate, the longer the half-life. b. the decay rate is not related to the half-life. c. the more rapid the decay rate, the shorter the half-life. d. the slower the decay rate, the shorter the half-life.
c. the more rapid the decay rate, the shorter the half-life.
Most fats are composed of how many fatty acids along with glycerol? a. one b. two c. three d. four
c. three
The nuclear reaction that changes one element into another element is called a a. half-life b. decay series c. transmutation d. chemical reaction
c. transmutation
What is the oxidation number of N in the compound KNO3? a. +2 b. +3 c. +4 d. +5
d. +5
The complementary base sequence in the RNA bound to a DNA strand with the base sequence C-C-G-A-T-T would be ____________________. a. -G-G-C-T-A-A- b. -A-A-U-C-G-G- c. -C-C-G-A-T-T- d. -G-G-C-U-A-A-
d. -G-G-C-U-A-A-
The following reaction is at equilibrium: PBr3 + Br2⇄PBr5 The equilibrium [Br2] and [PBr5] are 2.05 M and 0.55 M, respectively. If the Keq is 1.65, what is the equilibrium [PBr3]? a. 16.3 M b. 1.63 M c. 1.65 M d. 0.163 M
d. 0.163 M
Given the balanced chemical equation: Fe2O3(s) + 3SO3(g) → Fe2(SO4)3 How many molecules of Fe2(SO4)3 are produced if 300 atoms of SO3 are reacted? a. 900 atoms b. 600 atoms c. 300 atoms d. 100 atoms
d. 100 atoms
The half-life of a radioactive nucleus is 27.0 seconds. The time required for all except 1.50 grams of a 24.0 g sample of this nuclide to decay is _____. a. 54.0 sec b. 81.0 sec c. 135 sec d. 108 sec
d. 108 sec
If the following equation is balanced, what coefficent is found in front of O2? S8 + O2---> SO3 a. 4 b. 6 c. 10 d. 12
d. 12
What is the molar mass of C6H12O6? a. 72.07 g/mol b. 12.09 g/mol c. 95.99 g/mol d. 180.16 g/mol
d. 180.16 g/mol
If a radioactive sample has an activity of 65 µCi, how many disintegrations per second are occurring? a. 2.41 × 108^ disintegrations per second b. 2.41 × 10^2 disintegrations per second c. 2.41 × 10^3 disintegrations per second d. 2.41 × 10^6 disintegrations per second
d. 2.41 × 10^6 disintegrations per second
What is the voltage of this half reaction? 2F− → F2 + 2e− a. -5.74 V b. -2.87 V c. 5.74 V d. 2.87 V
d. 2.87 V
A sample of radium has an activity of 16.0 mCi. If the half-life of radium is 1,600 y, how long before the sample's activity is 5.6 mCi? a. 1620 y b. 2400 y c. 3200 y d. 2420 y
d. 2420 y
What is the coefficient for oxygen when the following equation for the combustion of octane is correctly balanced? C8H18 + ___O2 -----> ___CO2 + ___H2O a. 12.5 b. 9 c. 16 d. 25
d. 25
What mass of H2O is produced by the combustion of 1.00 mol of CH4? CH4(g) + 2O2(g) → CO2(g) + 2H2O(ℓ) a. 2.00 grams b. 18.01 grams c. 16.04 grams d. 36.02 grams
d. 36.02 grams
A chemist combusts a 3.009 g sample of C5H12 and obtains 3.774 g of H2O. What is the theoretical yield? C5H12(ℓ) + 8O2(g) → 5CO2 + 6H2O(ℓ) a. 3.009 grams b. 3.774 grams c. 18.054 grams d. 4.51 grams
d. 4.51 grams
Given the chemical equation: Na(s) + H2O(ℓ) → NaOH(aq) + H2(g) How many molecules of H2 are produced when 400 atoms of Na react? a. 100 b. 200 c. 300 d. 400
d. 400
Which of the equations below represents the balanced redox reaction in acidic solution for the following reaction? Cu + NO3− → Cu2+ + NO2 a. 2H2O + Cu + 2NO3− → Cu2+ + 2NO2 + 4OH− b. 2H2O + Cu + 2NO3− → Cu2+ + 2NO2 + 4OH− c. 2H+ + Cu + 2NO3− → Cu2+ + 2NO2 + 2H2O d. 4H+ + Cu + 2NO3− → Cu2+ + 2NO2 + 2H2O
d. 4H+ + Cu + 2NO3− → Cu2+ + 2NO2 + 2H2O
What mass of PbSO4 is produced when 29.6 g of H2SO4 are reacted? Pb(s) + PbO2(s) + 2H2SO4(aq) → 2PbSO4(s) + 2H2O(ℓ) a. .301 grams b. 303.26 grams c. 30.37 grams d. 91.28 grams
d. 91.28 grams
For the following balanced displacement reaction, which of the following compounds would be the precipitate in the reaction? 2 AlCl3(aq) + 3 Na2CO3(aq) -----> 6 NaCl + Al2(CO3)3 a. AlCl3 b. Na2CO3 c. NaCl d. Al2(CO3)3
d. Al2(CO3)3
The ribosome is a cell part that... a. is the site of protein synthesis. b. is the site where the translation process occurs. c. is the place were amino acids are conveyed by tRNA molecules to be assembled in a specific order. d. All of these are correct choices.
d. All of these are correct choices.
A RNA molecule differs from a DNA molecule because... a. RNA contains ribose. b. RNA is a single strand of nucleotides. c. RNA contains uracil, but not thymine. d. All of these.
d. All of these.
The alpha decay of ^14258Ce produces a nucleus of _____. a. Cs b. La c. Xe d. Ba
d. Ba
Which of the following equations below represents the balanced redox reactions by the half reaction method for the following equation? Ca + H+ → Ca2+ + H2 a. Ca + 2H+ → Ca2+ + 2H2 b. 2Ca + 2H+ → Ca2+ + H2 c. Ca + 2H+ →2 Ca2+ + H2 d. Ca + 2H+ → Ca2+ + H2
d. Ca + 2H+ → Ca2+ + H2
Which of the following is an isotope that contributes to the radioactivity in our bodies? a. Chlorine-37 b. Sodium-22 c. Fluorine-20 d. Carbon-14
d. Carbon-14
How would you classify the following reaction? CH4 + 2O2 ----> 2H2O + CO2 a. Neutralization Reaction b. Single Replacement Reaction c. Double Replacement Reaction d. Combustion Reaction
d. Combustion Reaction
How would you classify the following reaction? CuCl2(aq) + 2AgNO3(aq) → Cu(NO3)2(aq) + 2AgCl(s) a. Composition Reaction b. Decomposition Reaction c. Single Replacement Reaction d. Double Replacement Reaction
d. Double Replacement Reaction
Which of the following equations is not balanced? a. 2H2 + O2 ------> 2H2O b. 2KClO3 ------> 2KCl + 3O2 c. 2SO2 + O2 ------> 2SO3 d. H2O2 ------> H2O + O2
d. H2O2 ------> H2O + O2
What is the acid in a lead-acid storage battery? a. H3PO4 b. HClO4 c. HCl d. H2SO4
d. H2SO4
Which of the following chemical equations would be classified as a neutralization reaction? a. 2Mg + Cl2--->2MgCl b. 2CaO----> 2Ca + O2 c. CH4 + 2O2 ---> 2H2O + CO2 d. HCl + KOH --->KCl + H2O
d. HCl + KOH --->KCl + H2O
The ICE method can be employed to calculate the concentrations of reactants and products after an equilibrium system has been altered. What do the letters ICE stand for? a. Information, Center, Environment b. Initial, chemical, Equilibrium c. Information, Change, Equilibrium d. Initial, Change, Equilibrium
d. Initial, Change, Equilibrium
Which of the following are spectator ions when solutions of ammonium sulfate is added to a saturated solution of barium hydroxide. (NH4)2SO4(aq) + Ba(OH)2(aq) ---> BaSO4(s) + 2 (NH4)OH(aq) a. NH4 and SO4 b.Ba and SO4 c. Ba and OH d. NH4 and OH
d. NH4 and OH
Which of the following is an element that can only be produced through the process of electrolysis? a. Fe b. Ca c. Pb d. Na
d. Na
For the following balanced displacement reaction, which of the following compounds would be the precipitate in the reaction? ZnSO4(aq) +SrCl2(aq) ----> ZnCl2 + SrSO4 a. ZnSO4 b. SrCl2 c. ZnCl2 d. SrSO4
d. SrSO4
If the forward reaction in a chemical equilibrium is favored: a. The concentration of reactants increases, while the concentration of products decreases. b. The concentration of reactants increases, while the concentration of products stays the same. c. The concentration of reactants stays the same,, while the concentration of products increases. d. The concentration of reactants decreases, while the concentration of products increases.
d. The concentration of reactants decreases, while the concentration of products increases.
Which country generates the least amount of electricity by nuclear fission? a. Sweden b. Belgium c. France d. United States
d. United States
Which of the following is the equilibrium expression for the reaction below? A(s) + 2B(g) + 3C(g) <--->3D(g) a. [A][B]^2[C]^3/[D]^3 b. [A][B][C]/[D] c. [D]^3/[A][B]^2[C]^3 d. [D]^3/[B]^2[C]^3
d. [D]^3/[B]^2[C]^3
In order for a small molecule to qualify for use as a monomer in making an addition polymer, it must have... a. a very low boiling point. b. at least 10 carbon atoms in a row. c. an oxygen atom. d. a double bond between carbon atoms.
d. a double bond between carbon atoms.
Stresses to an equilibrium system include changes in a. pressure b. concentration of Reactants/Products c. temperature d. all of the above
d. all of the above
Ethylene glycol, a dialcohol, is the main ingredient in a. tobacco humectants b. denaturated alcohol c. gasohol d. antifreeze
d. antifreeze
Carbon dating measures when the organism died because only then does a. carbon-14 decay to carbon-12 b. carbon-12 decay to nitrogen-12 c. carbon-12 decay to carbon-14 d. carbon-14 decay to nitrogen-14
d. carbon-14 decay to nitrogen-14
The polysaccharide that is the major structural material of wood and plants is ____________________. a. amylopectin b. glycogen c. amylose d. cellulose
d. cellulose
Addition polymers are made from molecules that... a. contain two functional groups. b. contain sulfur atoms. c. contain only single bonds. d. contain some double bonds.
d. contain some double bonds.
The half-life of 6027Co is 5.2 years. This means that after 5.2 years a sample of 6027Co ... a. breaks in half. b. turns into 3027Co. c. has a 50% chance of exploding. d. contains one-half as many 6027Co atoms as the original sample.
d. contains one-half as many 6027Co atoms as the original sample.
During alpha emission, the mass number of the radioactive isotope _____. a. increases by 2 b. decreases by 2 c. increases by 4 d. decreases by 4
d. decreases by 4
What produces the tremendous energy of a nuclear fission reaction? a. some mass being changed into energy b. the splitting of the nucleus c. the extra neutrons produced d. disintegration of the containment building
d. disintegration of the containment building
A triacylglycerol (triglyceride) that is solid at room temperature is called a(n) ______. a. steroid b. oil c. wax d. fat
d. fat
The splitting of a nucleus by a slow moving neutron is called a. fusion b. fragmentation c. annihilation d. fission
d. fission
The half-life of a radionuclide is dependent on the _____ of the radioactive nucleus. a. temperature b. concentration c. pressure d. identity
d. identity
A saturated fatty acid... a. contains some double bonds. b. can be hydrogenated further. c. has a lower melting point than a same-length fatty acid with unsaturations. d. is none of the above.
d. is none of the above.
In an oxidation-reduction reaction, the oxidizing agent... a. is oxidized. b. loses electrons. c. accepts a proton. d. is reduced.
d. is reduced
Reducing agents: a. gain electrons and get oxidized b. lose electrons and get reduced c. gain electrons and get reduced d. lose electrons and get oxidized
d. lose electrons and get oxidized
Compared to saturated fatty acids, unsaturated fatty acids have... a. longer carbon chains. b. shorter carbon chains. c. higher melting points. d. lower melting points. e. greater intermolecular attraction.
d. lower melting points.
Carbohydrates are produced in the green leaves of plants by the process of ____________________. a. respiration b. metabolism c. hydrolysis d. photosynthesis
d. photosynthesis
Which does not contain a nitrogen atom in its structure? a. amide b. amine c. nylon d. polyester
d. polyester
The purpose of a salt bridge in a voltaic cell is to... a. provide a pathway for electrons to flow from cathode to anode. b. ensure that the positive charge in the cell remains significantly greater than the negative charge. c. ensure that the negative charge in the cell remains significantly greater than the positive charge. d. provide a means for ions to enter either container to maintain electrical neutrality.
d. provide a means for ions to enter either container to maintain electrical neutrality.
When calcium reacts with something else and forms an ion, calcium is acting as a(n) ______. a. anion b. atom that gains electrons c. oxidizing agent d. reducing agent
d. reducing agent
A battery which may be recharged is called a(n) a. primary battery b. dry cell c. electroplating cell d. secondary battery
d. secondary battery
The loss of an alpha particle by a radioactive nucleus causes... a. no change in mass number. b. the atomic number to decrease by 4. c. the mass number to decrease by 2. d. the atomic number to decrease by 2.
d. the atomic number to decrease by 2.
Organic chemistry is most broadly defined as a. the chemistry of the non-metallic compounds. b. the chemistry of substances produced by living systems. c. the chemistry of living systems. d. the chemistry of the compounds of carbon.
d. the chemistry of the compounds of carbon.
The half-life of a radioactive isotope (radio isotope) is... a. one-half of the time it takes for the radioisotope to completely decay to a nonradioactive isotope. b. the time it takes for the radioisotope to become an isotope with one-half the atomic number of the original radioisotope. c. the time it takes for the radioisotope to lose one-half of its neutrons. d. the time it takes for one-half of the sample to decay.
d. the time it takes for one-half of the sample to decay.
In a valid chemical equation... a. the number of products must equal the number of reactants. b. the reactants always appear on the right-hand side of the equation. c. only reactants and products that are solids or liquids are listed. d. the total number of atoms on each side of the equation must be equal.
d. the total number of atoms on each side of the equation must be equal.
When condensation polymers are formed, a substance besides the polymer is formed. What is that substance? a. ammonia b. hydrogen cyanide c. hydrogen gas d. water
d. water
A polyunsaturated fatty acid contains more than one ______. a. carboxyl group b. hydroxyl group c. carbonyl group d. long carbon chain e. double bond
e. double bond
