Chapter 23: Organic Chemistry

Identify the correct condensed structural formulas for the following line structures.

(C2H5)2CHCH2CH(CH3)2 (CH3)3CCH2CH(CH3)CH(CH3)CH(CH3)2(CH3)3CCH2CH(CH3)CH(CH3)CH(CH3)2 CH3CH2CH(CH3)C(CH3)2CH2CH2CH3CH3CH2CH(CH3)C(CH3)2CH2CH2CH3 (CH3)3CCH2CH(CH3)CH2C(CH3)3

Identify whether each of the following carbon atoms is primary (1∘), secondary (2∘), tertiary (3∘), or quaternary (4∘). Drag the appropriate labels to their respective targets.

3 4 2 1 1 3

Name the alkane shown in the model.

3,4-dimethylhexane

What is the name of the following organic compound? CH3CH2CCCH2CH2CH3

3-heptyne

What is the name of the following organic compound? CH3CH2CH2CH2CH2CH2CH2CH3

octane

Locate and identify the functional groups in the following molecules:

alcohol carboxylic acid

Classify the organic compounds by the class of their functional group.

Alcohol HOCH2CH3 Carboxylic acid CH3CH2COOH Amine CH3CH2CH2NH2 Ketone CH3COCH3 Aldehyde CH3CH2

What is the molecular formula for the alkane shown in the model?

C8H18

Give the formula of the following molecular model.

C7H16

Styrene, used to make polystyrene

aromatic ring alkene