Chem 140b Final

Which compound is soluble in heptane, but not water? A) (CH3)2CH(CH2)5CHO B) CH3CH2COCH2CH3 C) CH3CH2CHO D) All are soluble in water and hexane.

A) (CH3)2CH(CH2)5CHO

Which alcohol is soluble in water? A) (CH3)2CHCH2OH B) CH3(CH2)10CH2OH C) CH3CH2CH2CH2CH2CH2CH2OH D) All alcohols are soluble in water

A) (CH3)2CHCH2OH

Which is not a valid IUPAC name of an alkane? A) 2-ethylhexane B) 4-methyl-4-propyloctane C) 3-ethyl-2-methylpentane D) 5-butyl-2-methylnonane

A) 2-ethylhexane

Which is the molecular formula of an alkyne? A) C6H10 B) C5H10 C) C4H10 D) C6H12

A) C6H10 (CnH2n-2)

Which compound has the highest boiling point? A) CH3(CH2)4CH2OH B) CH3(CH2)2O(CH2)2CH3 C) CH3(CH2)5CH3 D) All of the above have the same.

A) CH3(CH2)4CH2OH

_______ is responsible for the sting of some types of ants. A) Formic acid B) Acetic acid C) Hexanoic acid D) Propanoic acid

A) Formic acid

Since oxygen is more electronegative than carbon, a carbonyl group is polar. A) True B) False

A) True

What type of sugar is lactose? A) a disaccharide B) a polysaccharide C) a monosaccharide D) an aldohexose

A) a disaccharide

What is the product of the reduction of an unsubstituted aldehyde? A) a primary alcohol B) a carboxylic acid C) a secondary alcohol D) an ether E) a tertiary alcohol

A) a primary alcohol

Which is a hydrolyzable lipid? A) a tricylglycerol B) a steroid C) an eicosanoid D) a fat-soluble vitamin E) More than one.

A) a triacylglycerol

Which functional group contains a carbonyl carbon? A) amide B) ether C) hydroxyl D) amine

A) amide

What is the IUPAC name of CH3CH2CH2CH3? A) butane B) methane C) propane D) pentane

A) butane

What is the most common multiple bond between carbon and a heteroatom? A) carbon-oxygen double bond (C=O) B) carbon-nitrogen double bond (C=N) C) carbon-nitrogen single bond (C-N) D) carbon-sulfur double bond (C=S)

A) carbon-oxygen double bond (C=O)

What are the products of the acid catalyzed hydrolysis of an amide? A) carboxylic acid and amine B) carboxylate salt and amine C) carboxylic acid and ammonium salt D) carboxylate salt and ammonium salt E) none of the above

A) carboxylic acid and amine

What configuration of a double bond is more common is naturally occurring fatty acids? A) cis B) trans C) cis and trans are equally likely to occur

A) cis

The structure of lipids is A) dominated by hydrophobic regions B) dominated by hydrophilic regions C) equally dominated by hydrophilic and hydrophobic regions

A) dominated by hydrophobic regions

When converting a Fischer projection to a Haworth projection, where are all of the substituents on the right side of the carbon skeleton drawn in the Haworth projection? A) down B) up C) down in alpha anomer and up in beta anomer D) down in beta anomer and up in alpha anomer

A) down

What process is used to move ions, specifically Cl- and HCO3-, through a cell membrane, traveling from the side of higher concentration to lower concentration? A) facilitated diffusion B) diffusion C) active transport

A) facilitated diffusion

The simplest amide is A) formamide B) acetamide C) acetone D) methane E) methanamine

A) formamide

What monosaccharide is found in cellulose, starch, and glycogen? A) glucose B) galactose C) N-acetyl-D-glucosamine D) fructose E) more than one

A) glucose

Which is not an example of a lipid? A) phenol B) triacylglycerol C) cholesterol D) vitamin E

A) phenol

Which type of fatty acid is most common in coconut oil? A) saturated B) monounsaturated C) polyunsaturated D) trans E) omega-3

A) saturated

What product is formed when tripropylamine is treated with acetic acid? A) tripropylammonium acetate B) tripropylammonia acetate C) tripropanammonium acetate D) tripropanammonia acetate

A) tripropylammonium acetate

What hydrolysis products are formed when the acetal (CH3CH2CH2)2C(OCH2CH3)2 is treated with H2SO4 in H2O? A) (CH3CH2CH2)2CHOCH2CH3 + CH3CH2OH B) (CH3CH2CH2)2CO + 2 CH3CH2OH C) (CH3CH2CH2)2CHOH + 2 CH3CH2OH D) CH2(OCH2CH3)2 + 2 CH3CH2CH3

B) (CH3CH2CH2)2CO + 2 CH3CH2OH

How many tertiary carbons are in (CH3)3CCH2CH(CH3)2? A) 0 B) 1 C) 2 D) 3 E) none of the above

B) 1

What is the name of the product from the hydration of 1-methylcyclopentene? A) 1-methylcyclopentane B) 1-methylcyclopentanol C) 2-methylcyclopentanol D) 1-methyl-2-cyclopentanol E) 0-chlorophenol

B) 1-methylcyclopentanol

What determines blood type in humans? A) 3 or 4 proteins attached to a membrane monosaccharide on the surface of a red blood cell B) 3 or 4 monosaccharides attached to a membrane protein on the surface of a red blood cell C) 4 or 5 proteins attached to a membrane monosaccharide on the surface of a red blood cell D) 4 or 5 monosaccharides attached to a membrane protein on the surface of red blood cells

B) 3 or 4 monosaccharides attached to a membrane protein on the surface of a red blood cell

Which statement is not true? A) Once the chemical message is delivered, the neurotransmitter is degraded or returned to the presynaptic neuron to begin the process again. B) All neurotransmitters are quaternary ammonium ions. C) Norepinephrine, dopamine, and serotonin are important neurotransmitters. D) Norepinephrine and serotonin are both synthesized from the amino acid tyrosine.

B) All neurotransmitters are quaternary ammonium ions.

Which of these structure represents a soap? A) CH3CO2-K+ B) CH3(CH2)14CO2-Na+ C) CH3(CH2)12COOH D) CH3(CH2)7CO2(CH2)7Na E) More than one.

B) CH3(CH2)14CO2-Na+

What is the product formed when CH3(CH2)4CHO undergoes reduction? A) CH3(CH2)4COOH B) CH3(CH2)4CH2OH C) CH3(CH2)4=CH2 D) CH3(CH2)4COC(CH2)4CH3 E) No reaction

B) CH3(CH2)4CH2OH

Which compound has the highest boiling point? A) (CH3)2CHCH2COOCH3 B) CH3CH2CH2CH2CH2COOH C) (CH3)2CHCH2CH2CH2OH D) CH3(CH2)6CH3 E) All have the same.

B) CH3CH2CH2CH2CH2COOH

Which compound has the lowest boiling point? A) CH3(CH2)5CONH2 B) CH3CH2CON(CH2CH3)2 C) CH3CH2CH2CH2CONHCH2CH3 D) All have the same.

B) CH3CH2CON(CH2CH3)2

Which element is not a common heteroatom in organic compounds? A) N B) Na C) O D) Cl E) F

B) Na

The general formula for an aldehyde is A) RCOOH B) RCHO C) RCOR D) R2CO E) RCH2OH

B) RCHO

Which is not a fat-soluble vitamin? A) Vitamin A B) Vitamin C C) Vitamin E D) Vitamin K E) All of the above are fat soluble.

B) Vitamin C

In a disaccharide, the C-O bond that joins the two rings together is called A) a hemiacetal B) a glycosidic linkage C) an alditol D) an anomer

B) a glycosidic linkage

Heating a carboxylic acid with a primary amine forms _______ + water. A) a primary acid B) a secondary amide C) a tertiary amide D) an ester

B) a secondary amide

What are monosaccharides with a carbonyl group at C1 called? A) anomers B) aldoses C) ketoses D) alditols

B) aldoses

A hemiacetal contains A) an OH (hydroxyl) group and an OR (alkoxy) group B) an OH group and and OR group bonded to the same carbon C) two OR groups bonded to the same carbon D) two OR groups

B) an OH group and an OR group bonded to the same carbon

When an alkene reacts with bromine, Br2, the reaction is called A) hydrogenation B) halogenation C) hydrohalogenation D) hydration E) none of the above

B) halogenation

_________ transports cholesterol from the tissues back to the liver. A) low density lipoproteins B) high density lipoproteins C) eicosanoids D) leukotrines E) steroids

B) high density lipoproteins

Which carbohydrates cannot be converted to simpler compounds by hydrolysis? A) disaccharides B) monosaccharides C) polysaccharides

B) monosaccharides

Which type of fatty acid is most common in olive oil? A) saturated B) monounsaturated C) polyunsaturated D) trans E) omega-3

B) monounsaturated

What is the name of the class of compounds with the general formula of R4N+X-? A) tertiary ammonium salts B) quaternary ammonium salts C) tetraammonium salts D) tertiary ammonia salts

B) quaternary ammonium salts

Soaps are A) fatty acids B) salts of carboxylic acids that have many carbon atoms in a long hydrocarbon chain C) salts of carboxylic acids that have many carbon atoms in a short hydrocarbon chain D) carboxylic acids

B) salts of carboxylic acids that have many carbon atoms in a long hydrocarbon chain

What reaction does the coenzyme NADH, in the presence of an enzyme, facilitate? A) the reduction of a carbonyl group to form a carboxylic acid B) the reduction of a carbonyl group to form an alcohol C) the reduction of a carboxylic acid to form a carbonyl group D) the oxidation of a carbonyl group to form an alcohol E) the oxidation of a carbonyl group to form a carboxylic acid

B) the reduction of a carbonyl group to form an alcohol

Why are humans not able to digest cellulose? A) we can't digest glucose B) we don't posses the enzyme b-glycosidase C) we cannot digest amylose D) we don't possess enzyme a-gylcosidase

B) we don't possess the enzyme b-glycosidase

How many triacylglycerols can be prepared from 3 different fatty acids? A) 3 B) 6 C) 18 D) 27

C) 18

How many primary carbon atoms are in the molecule C3H8? A) 0 B) 1 C) 2 D) 3 E) 4

C) 2

How many triacylglycerols can be prepared from two different fatty acids? A) 2 B) 4 C) 6 D) 8

C) 6

Which formula represents an acyclic alkane? A) C11H20 B) C10H20 C) C13H28 D) C11H22 E) C13H30

C) C13H28

Which molecular formula has the highest number of constitutional isomers? A) C5H12 B) C2H6 C) C6H14 D) All of the above have the same number of constitutional isomers.

C) C6H14

The smell of fried onions is in part determined by the disulfide CH2=CHCH2S-SCH2CH2CH3. What thiol(s) is(are) formed from the reduction of this disulfide? A) CH3CH2CH2S-SCH2CH2CH3 B) 2 CH3CH2CH2SH C) CH2=CHCH2SH + CH3CH2CH2SH D) 2 CH3CH2CH2=S E) CH4 + CH3CH2S-SCH2CH2CH3

C) CH2=CHCH2SH + CH3CH2CH2SH

Which compound has the highest boiling point? A) CH3(CH2)5CH3 B) CH3(CH2)4CHO C) CH3(CH2)4CH2OH D) All have the same.

C) CH3(CH2)4CH2OH

Which compound is soluble in water? A) CH3(CH2)5CHO B) CH3(CH2)4COCH2CH3 C) CH3CH2CHO D) All are soluble.

C) CH3CH2CHO

Which statement is not true? A) Cholesterol is the most prominent member of the steroid family. B) Cholesterol is insoluble in the aqueous medium of the blood. C) Cholesterol serves as a starting material for the synthesis of all other steroids and Vitamin A. D) Cholesterol is a vital component for healthy cell membranes. E) Cholesterol in synthesized in the liver.

C) Cholesterol serves as a starting material for the synthesis of all other steroids and vitamin A.

Which reagent can be used to reduce a ketone? A) K2CrO7 B) H2SO4 C) H2 with Pd metal D) Ag2O in aqueous NH4OH

C) H2 with Pd metal

What reagents are necessary to turn cyclopentene into bromocyclopentane? A) H2/Pd B) Br2 C) HBr D) H20/H2SO4

C) HBr

What is the treatment of a carboxylic acid with an alcohol in the presence of an acid catalyst to form an ester called? A) an addition reaction B) an acid-base reaction C) a Fischer esterification D) a saponification

C) a Fischer esterification

What two types of compounds react to form a wax? A) a fatty acid and an amide B) a high molecular weight alcohol and a steroid C) a fatty acid and a high molecular weight alcohol D) an ester and a fatty acid

C) a fatty acid and a high molecular weight alcohol

Which is a hydrolyzable lipid? A) a leukotrine B) cholesterol C) a phosphoacylglycerol D) vitamin A E) more than one

C) a phosphoacylglycerol

What is the product of the reduction of an unsubstituted ketone? A) a primary alcohol B) a carboxylic acid C) a secondary alcohol D) an ether E) a tertiary alcohol

C) a secondary alcohol

Reduction of a ketone produces a(n) A) aldehyde B) ether C) alcohol D) carboxylic acid E) alkene

C) alcohol

Saturated hydrocarbons are A) alkenes B) aromatic hydrocarbons C) alkanes D) alkynes E) All of the above

C) alkanes

What is the most common type of starch molecule? A) cellulose B) amylose C) amylopectin D) glycogen

C) amylopectin

What is the long stem that protrudes from a cell body at one end and ends in numerous small filaments at its opposite end? A) a dendrite B) a synapse C) an axon D) a vesicle

C) an axon

Which is a nonhydrolyzable lipid? A) a triacylglycerol B) a wax C) an eicosanoid D) a phospholipid E) More than one.

C) an eicosanoid

What are the products of the acid catalyzed hydrolysis of an amide? A) carboxylic acid, amine B) carboxylate salt, amine C) carboxylic acid, ammonium salt D) carboxylate salt, ammonium salt E) None of the above

C) carboxylic acid, ammonium salt

Which does not occur as a result of the release of epinephrine? A) dilation of lung passages B) increase in heart rate C) decrease in glucose synthesis D) increase in blood pressure E) All occur after release of epinephrine.

C) decrease in glucose synthesis

What functional group is contained in most hydrolyzable lipids? A) amide B) ether C) ester D) carboxylic acid E) hydroxy

C) ester

Which has the lowest boiling point? A) octane B) butane C) ethane D) hexane E) propane

C) ethane

Which functional group does not contain a carbonyl carbon? A) aldehyde B) carboxyl group C) ether D) ester E) ketone

C) ether

Linolenic acid, CH3CH2CH=CHCH2CH=CH(CH2)7COOH, is an A) omega-6 acid B) omega-9 acid C) omega-3 acid D) omega-14 acid

C) omega-3 acid

What is the main component of a cell membrane? A) triacylcglycerols B) leukotrines C) phospholipids D) prostoglandins E) steroids

C) phospholipids

What is the name of the ketone with the shortest possible carbon chain? A) methanone B) ethanone C) propanone D) butanone E) ethyl methyl ketone

C) propanone

Which of these groups of compounds are phospholipids? A) leukotrines B) fatty acids C) sphingomyelins D) adrenal cortical steroids

C) sphingomyelins

The molecule cis-2-pentene and trans-2-pentene are examples of A) isotopes B) constitutional isomers C) stereoisomers D) identical molecules

C) stereoisomers

Which is not a reducing sugar? A) glucose B) fructose C) sucrose D) galactose E) aldopentose

C) sucrose

Carboxylic acids react with bases, such as NaOH, to form A) alcohols B) carboxylate anions + H3O+ C) water-soluble salts D) carboxylic acids

C) water-soluble salts

What is the condensed structure of C4H10?

CH3CH2CH2CH3

How many hydrogen atoms are present in a cyclic alkane with 6 carbon atoms? A) 6 B) 8 C) 10 D) 12 E) 14

D) 12 (CnH2n)

What is the name of the product of the reaction of 1-pentyne with 2 eq. of HBr? A) 2,2,3,3-tetrabromopentane B) 2-bromo-pentene C) 1,1-dibromopentane D) 2,2-dibromopentane E) more than one product

D) 2,2-dibromopentane

How many covalent bonds does carbon almost always form in compounds? A) 1 B) 2 C) 3 D) 4 E) the number varies.

D) 4

Which formula represents a cyclic alkane? A) C13H24 B) C13H28 C) C12H26 D) C13H26 E) C14H26

D) C13H26

What does the complete metabolism of a triacylglycerol yield? A) glycerol, fatty acids, and a great deal of energy B) fatty acids and a great deal of energy C) fatty acids, H2O, and a great deal of energy D) CO2, H2O, and a great deal of energy

D) CO2, H2O, and a great deal of energy

Which formula represents an inorganic compound? A) CH3CO2CH2CH3 B) CH3NHCH2CH3 C) ClCCCl D) CaCl2

D) CaCl2

Which statement is not true? A) Vitamin A is obtained from liver, oily fish, and dairy. B) Vitamin E is an antioxidant, protecting unsaturated side chains in fatty acids from unwanted oxidation. C) A severe deficiency of vitamin K leads to excessive and sometimes fatal bleeding because of inadequate blood clotting. D) Vitamin A helps regulate both calcium and phosphorus metabolism.

D) Vitamin A helps regulate both calcium and phosphorus metabolism. (its vit C)

Which of the following react to form an acetal? A) an acid and an alcohol B) a hemiacetal and an acid C) an aldehyde and H2/Pd D) a hemiacetal and an alcohol

D) a hemiacetal and an alcohol

What is the hydrolysis reaction of an ester by a base called? A) an addition reaction B) a substitution reaction C) a Fischer esterification D) saponification

D) a saponification

Which of the following are listed in order of increasing boiling point? A) ether<alcohol<aldehyde B) aldehyde<alkyne<alcohol C) ether<aldehyde<alkane D) alkane<ether<alcohol E) more than one correct

D) alkane<ether<alcohol

What types of compounds can be used to hydrolyze triacylglycerols? A) enzymes (in biological systems) B) bases C) acids D) All of the above. E) None of the above.

D) all of the above

What products are produced when a carboxylic acid reacts with an alcohol, in the presence of sulfuric acid? A) an ether B) an ether + water C) an ester D) an ester + water E) an amide + water

D) an ester + water

What is the shape of the oxygen atom in an alcohol? A) tetrahedral B) trigonal planar C) trigonal pyramidal D) bent E) linear

D) bent

What is the name for CH3CH2OCH3? A) epoxide B) methyl ethyl ether C) trimethyl ether D) ethyl methyl ether E) none of the above

D) ethyl methyl ether

What is the most common form in which polysaccharides are stored in animals? A) cellulose B) amylose C) amylopectin D) glycogen

D) glycogen

What is Tollen's reagent? A) potassium dichromate B) sulfuric acid C) chlorine D) silver (I) oxide in aqueous ammonium hydroxide

D) silver (I) oxide in aqueous ammonium hydroxide

What are the small packets that store neurotransmitters? A) dendrites B) synapses C) axons D) vesicles

D) vesicles

How many hydrogen atom are presents in an acyclic alkane with 5 carbon atoms? A) 5 B) 7 C) 9 D) 10 E) 12

E) 12 (CnH2n+2)

What is the IUPAC name for the molecule CH3CH=CHCH2CH3? A) pentene B) pent-3-ene C) 3-pentene D) pent-2-ene E) 2-pentene

E) 2-pentene

Which is a neurotransmitter? A) serotonin B) dopamine C) norepinephrine D) A and B E) A, B, and C

E) A, B, and C

In what ways may drugs be used to affect neurotransmitters? A) A drug may prevent binding of a neurotransmitter to a receptor. B) A drug may increase the amount of neurotransmitter released. C) A drug may prevent the release of a neurotransmitter. D) A drug may affect the degradation of a neurotransmitter. E) Drugs may affect neurotransmitters using all of the mechanisms listed above.

E) Drugs may affect neurotransmitters using all of the mechanisms listed.

Which is not a neurotransmitter? A) serotonin B) dopamine C) norepinephrine D) acetylcholine E) tryptophan

E) tryptophan