Biochemistry

Which set of molecules is best represented by letter A and B?

A:carbon dioxide and water.B:glucose.

C6H12O6+C6H12O6+(C6H12O6)---Y-->polysaccharide+ Z Letter Y most likely represents?

An enzyme.

Most organism contain?

Both organic and inorganic compounds.

Which formula represents an organic compound ?

C12H22O11

Which compound is inorganic?

Carbon dioxide(CO2)

A chemical analysis of organisms from each Kingdom shows that living things are primarily composed of the elements?

Carbon,Hydrogen,Chlorine,and Sulfur.

How are glucose molecules produced by green plants usually processed?

Converted into starch by dehydration synthesis and stored in roots.

Water is classified as an inorganic compound because it?

Does not contain carbon.

Which molecule can be classified as organic?

Hydrogen12,carbon6,Nitrogen0,Oxygen6 and Calcium 0.

Proteins,starch,and DNA are similar in that they are all?

Organic compounds

In plants,a storage product that results from the dehydration synthesis of many glucose molecules is?

Starch.

Which statements describe starches,fats,proteins,and DNA?

They are complex molecules made from smaller molecules.

Which substance is an inorganic molecule?

Water

Which substance are inorganic compounds?

Water and salts.

The principal inorganic compound found in living things is?

Water.

The products represented by letter A are?

glucose molecules.

In a chemical analysis of a sample of animal tissue,Which element would most likely be found in the smallest quantity?

iodine.