Exam #2 Chapter's 13-14
Which alcohol is most soluble in water? A) (CH3)2CHCH2OH B) CH3CH2CH2CH2CH2CH2CH2OH C) CH3(CH2)10CH2OH D) All alcohols are soluble in water.
A) (CH3)2CHCH2OH B) CH3CH2CH2CH2CH2CH2CH2OH C) CH3(CH2)10CH2OH D) All alcohols are soluble in water.
Which fatty acid has the highest melting point? A) CH3(CH2)12COOH B) CH3(CH2)2CH=CH(CH2)8COOH C) CH3(CH2)2CH=CH(CH2)2CH=CH(CH2)4COOH D) CH3(CH2)14COOH
A) CH3(CH2)12COOH B) CH3(CH2)2CH=CH(CH2)8COOH C) CH3(CH2)2CH=CH(CH2)2CH=CH(CH2)4COOH D) CH3(CH2)14COOH
Which fatty acid has the lowest melting point? A) CH3(CH2)12COOH B) CH3(CH2)2CH=CH(CH2)8COOH C) CH3(CH2)2CH=CH(CH2)2CH=CH(CH2)4COOH D) CH3(CH2)14COOH
A) CH3(CH2)12COOH B) CH3(CH2)2CH=CH(CH2)8COOH C) CH3(CH2)2CH=CH(CH2)2CH=CH(CH2)4COOH D) CH3(CH2)14COOH
Which compound has the highest boiling point? A) CH3(CH2)4CH2OH B) CH3(CH2)2O(CH2)2CH3 C) CH3(CH2)5CH3 D) All of the compounds above have the same boiling point.
A) CH3(CH2)4CH2OH B) CH3(CH2)2O(CH2)2CH3 C) CH3(CH2)5CH3 D) All of the compounds above have the same boiling point.
Which types of compounds are saturated hydrocarbons? A) alkenes B) aromatic hydrocarbons C) alkanes D) alkynes E) All of the hydrocarbons above are unsaturated hydrocarbons.
A) alkenes B) aromatic hydrocarbons C) alkanes D) alkynes E) All of the hydrocarbons above are unsaturated hydrocarbons.
The compounds 1-pentene and cis-2-pentene are an example of a pair of A) isotopes. C) constitutional isomers. B) stereoisomers. D) identical molecules.
A) isotopes. B) stereoisomers. C) constitutional isomers. D) identical molecules.
The molecules cis-2-pentene and trans-2-pentene are an example of a pair of A) isotopes. C) constitutional isomers. B) stereoisomers. D) identical molecules.
A) isotopes. C) constitutional isomers. B) stereoisomers. D) identical molecules.
The compounds o-chlorophenol and m-chlorophenol are examples of A) molecules that are identical. B) molecules that are constitutional isomers. C) molecules that are stereoisomers. D) molecules that are isotopes.
A) molecules that are identical. B) molecules that are constitutional isomers. C) molecules that are stereoisomers. D) molecules that are isotopes.
How many different products are formed in the reaction of m-dibromobenzene with Cl2, using FeCl3 as a catalyst? A) 1 B) 2 C) 3 D) 4
A) 1 B) 2 C) 3 D) 4
How many different products are formed in the reaction of p-dibromobenzene with Cl2, using FeCl3 as a catalyst? A) 1 B) 2 C) 3 D) 4
A) 1 B) 2 C) 3 D) 4
Which is the molecular formula of an alkyne? A) C10H18 B) C9H18 C) C8H18 D) C10H20
A) C10H18 B) C9H18 C) C8H18 D) C10H20
What reagent is commonly used for alcohol dehydration? A) K2Cr2O7 B) H2SO4 C) Cl2 D) H2O
A) K2Cr2O7 B) H2SO4 C) Cl2 D) H2O
An organic compound is classified as aromatic if it is cyclic and has a fragrant odor. A) True B) False
A) True B) False
Aromatic hydrocarbons and alkenes undergo the same kind of addition reactions. A) True B) False
A) True B) False
Butter and lard are composed mostly of saturated fatty acids. A) True B) False
A) True B) False
Compounds containing two or more benzene rings that share carbon-carbon bonds are called polycyclic aromatic hydrocarbons (PAHs). A) True B) False
A) True B) False
Essential fatty acids cannot be synthesized by the human body and therefore must be obtained in the diet. A) True B) False
A) True B) False
Ethers are organic compounds that have two alkyl groups bonded to an oxygen atom. A) True B) False
A) True B) False
Fats are solids at room temperature and are generally formed from fatty acids having a large number of double bonds in their carbon chains. A) True B) False
A) True B) False
Markovnikov's rule is used to predict the addition products of benzene. A) True B) False
A) True B) False
Partial hydrogenation of soybean oil has the effect of decreasing the number of carbon-carbon double bonds in the oil. A) True B) False
A) True B) False
Phenols are antioxidants. A) True B) False
A) True B) False
Primary (1°) alcohols are first oxidized to aldehydes (RCHO), which are further oxidized to carboxylic acids (RCOOH). A) True B) False
A) True B) False
Propyl bromide is a primary alkyl halide. A) True B) False
A) True B) False
The addition of water to an alkene is called a hydrogenation reaction. A) True B) False
A) True B) False
The common name for methylbenzene is aniline. A) True B) False
A) True B) False
The compound below is expected to be soluble in water. CH3CH2CH2CH2--O--CH2CH3 A) True B) False
A) True B) False
The double bonds in naturally occurring fatty acids are typically trans. A) True B) False
A) True B) False
When an alkene undergoes an addition reaction, new atoms replace the hydrogen atoms on the carbons that are part of the double bond. A) True B) False
A) True B) False
What configuration of a double bond is more common in naturally occurring fatty acids? A) cis B) trans C) cis and trans are equally likely to occur.
A) cis B) trans C) cis and trans are equally likely to occur.
What is the product of the reaction 2-pentene + H2 ------> Pd A) pentane B) 2-pentane C) ethane + propane D) 2-pentyne
A) pentane B) 2-pentane C) ethane + propane D) 2-pentyne
What is the IUPAC name for the compound CH3CH=CHCH2CH3? A) pentene B) 2,3-pentene C) 3-pentene D) 2-pentene
A) pentene B) 2,3-pentene C) 3-pentene D) 2-pentene
What is the functional group in thiols? A) sulfide group B) sulfate group C) sulfhydryl group D) sulfite group
A) sulfide group B) sulfate group C) sulfhydryl group D) sulfite group
What is the shape around the oxygen atom in an alcohol? A) tetrahedral B) trigonal pyramidal C) trigonal planar D) bent E) linear
A) tetrahedral B) trigonal pyramidal C) trigonal planar D) bent E) linear
when naming cycloalkanes the double bond is located between?
C1 & C2
alkane
are compounds that contain a carbon-carbon double bond -nonpolar bonds -general formula is CnH2n -low melting & boiling points -insoluble in water
Alkynes
are compounds that contain a carbon-carbon triple bond -nonpolar bonds -general formula CnH2n-2 -low melting & boiling points -insoluble in water
Compounds w/ two double bonds are called?
dienes -dienes are named by changing the -ane ending of the parent alkane to -adiene -each double bond gets its own number
trans isomer
opposite sides of double bond
cis isomer
same side of double bond