Stupid Science test ima fail

What organelle is this?

Chloroplast

What's the pigment found within the organelle?

Chlorphyll

Formula for Cellular respiration

C6H12O6 + 6 O2 -> 6CO2 + 6H20 + ENERGY (ATP)

Formula for Photosynthesis

CO2+H2O=(light)C6H12O6+O2 CD+water= Glucose+oxygen

In aerobic cellular respiration, what three major steps are involved?

1) Glycolysis(2 ATP) 2) Krebs Cycle(2 ATP) 3) Electron Transport Chain(32 ATP)

Where do each of these three major steps take place(for eukaryotes)?

1)Glycolysis=Cytoplasm 2)Krebs cycle=Mitochondria 3)Electron Transport Chain=Mitochondria

A stack of Thylakoids is called?

Granum

In photosynthesis, what are the two major reactions that take place?

Light and Dark reactions(Calvin cycle)

Where do each of these reactions take place?

Light reaction takes place in the Thylakoids and Dark reaction takes place in the Stroma.