CHM 130 Final Study Guide
176. A 10.0 mL of 0.121 M H2SO4 is neutralized by 17.1 mL of KOH solution. The molarity of the KOH solution is ________. A) 0.207 M B) 0.414 M C) 0.0708 M D) 0.428 M E) 0.142 M
0.142 M
204. Iron-59 has a half-life of 44 days. A radioactive sample has an activity of 0.64 mBq. What isactivity of the sample after 88 days? A) 1.28 mBq B) 0.64 mBq C) 0.32 mBq D) 0.16 mBq E) 0080 mBq
0.16 mBq
215. What is the IUPAC name of the following compound? CH3-CH2-CH2-CH2-CH(CH3)-CH3 A) heptane B) methylhexane C) 5-methylhexane D) 2-methylhexane E) 2-methylpentane
2-methylhexane
338. The anticodon of UAG is ________. A) ATC B) UAG C) AAC D) AUC E) GAU
AUC
229. The reaction of hydrogen (H2) and propene using a platinum catalyst is called ________. A) combustion B) substitution C) addition D) neutralization E) condensation
addition
352. The components of ATP are ________. A) adenosine, ribose, and three phosphate groups B) aniline and three phosphate groups C) alanine, ribose, and three phosphate groups D) adenine, ribose, and three phosphate groups E) adenosine, deoxyribose, and three phosphate groups
adenine, ribose, and three phosphate groups
351. The main compound used to release energy for metabolism is ________. A) sucrose B) glucose phosphate C) adenosine triphosphate D) ribonucleic acid E) NA
adenosine triphosphate
298. In the peptide Ala-Try-Gly-Phe, the N-terminus is ________. A) alanine B) phenylalanine C) tryptophan D) aspartate E) glycine
alanine
265. To which chemical class does phenobarbital belong? A) ester B) amine C) amide D) alkane E) ether
amide
259. What physiologically active amine is responsible for the signs and symptoms encountered in an allergic reaction? A) histamine B) epinephrine C) diphenhydramine D) phenylephrine E) dopamine
histamine
230. The reaction of an alkene and water in the presence of an acid catalyst to produce an alcohol is called ________. A) hydrolysis B) alkoholysis C) halogenation D) hydration E) hydrohydration
hydration
332. In transcription, ________. A) the mRNA produced is identical to the parent DNA B) a double helix containing one parent strand and one daughter strand is produced C) uracil pairs with thymine D) both strands of the DNA are copied E) the mRNA produced is complementary to one strand of the DNA
the mRNA produced is complementary to one strand of the DNA
225. Alkenes and alkynes are called unsaturated compounds because ________. A) they have the maximum number of hydrogen atoms attached to each carbon in the compound B) they have fewer hydrogen atoms attached to the carbon chain than alkanes C) they have more hydrogen atoms attached to the carbon chain than alkanes D) they have more carbon atoms than alkanes E) they have fewer carbon atoms than alkanes
they have fewer hydrogen atoms attached to the carbon chain than alkanes
350. How many main stages of catabolism are there? A) one B) two C) three D) four E) five
three
164. For , the product of [H3O + ] and [OH- ] is ________. A) 1.0 × 10-14 B) 1.0 × 10-7 C) 1.0 × 10-1 D) 1.0 E) 1.0 × 1014
1.0 × 10-14
165. What is the [H3O + ] in a solution with [OH- ] = 1.0 × 10-12 M? A) 1.0 × 10-12 M B) 1.0 × 102 M C) 1.0 × 10-7 M D) 1.0 × 10-8 M E) 1.0 × 10-2 M
1.0 × 10-2 M
169. The [H3O + ] of a solution with pH = 2.0 is ________. A) 10 M B) -10 M C) 1.0 × 102 M D) 1.0 × 10-2 M E) 1.0 × 10-12 M
1.0 × 10-2 M
166. What is the [OH- ] in a solution that has a [H3O + ] = 1.0 × 10-6 M? A) 1.0 × 10-2 M B) 1.0 × 10-6 M C) 1.0 × 10-8 M D) 1.0 × 10-10 M E) 1.0 × 10-12 M
1.0 × 10-6 M
366. When combined with electron transport, one turn of the citric acid cycle produces ________ ATP. A) 20 B) 12 C) 10 D) 14 E) 2
10
153. Which solution is isotonic to a red blood cell? A) water B) 0.5% NaCl C) 2% glucose D) 0.9% NaCl E) 10% glucose
10% glucose
168. What is the pH of a solution with [OH- ] = 1.0 × 10-4 M? A) 10.0 B) -10.0 C) 4.0 D) -4.0 E) 1.0 × 10-10
10.0
202. Iodine-123, which is used for diagnostic imaging in the thyroid, has a half-life of 13 h. If 50.0 mg of I-123 were prepared at 8:00 A.M. on Monday, how many mg remain at 10:00 A.M. on the following day? A) 50.0 mg B) 25.0 mg C) 12.5 mg D) 6.25 mg E) 3.13 mg
12.5 mg
195. Nitrogen-17 undergoes beta decay. What is the isotope produced in the radioactive decay? A) 18 6C B) 13 5B C) 18 7N D) 13 9F E) 17 8O
17 8O
191. The product from the alpha decay of 235 92U is ________. A) 235 93Np B) 239 94Pu C) 231 90Th D) 233 80Ra E) 236 92U
231 90Th
367. The complete oxidation of glucose produces ________ ATP molecules. A) 2 B) 8 C) 12 D) 24 E) 32
32
227. What is the IUPAC name for the following compound? A) 4-chloro-4,5-dimethyl-2-hexene B) 3-chloro-1,3,4-trimethyl-1-pentene C) 3-chloro-2,3-dimethyl-4-hexene D) 3-chloro-2,3,5-trimethyl-4-pentene E) 3-chloro-1,3,4,4-tetramethyl-1-butene
4-chloro-4,5-dimethyl-2-hexene
167. What is the pH of a solution with [H3O + ] = 1.0 × 10-9 M? A) 1.0 × 10-5 B) -9.0 C) 5.0 D) -5.0 E) 9.0
5.0
260. Amines are ________. A) Brønsted-Lowry bases B) Brønsted-Lowry acids C) neutral in water solution D) unreactive E) acidic in water solution
Brønsted-Lowry bases
222. What is(are) the product(s) of the complete combustion of any hydrocarbon? A) CO only B) CO2 only C) CO + H2O D) CO2 + H2O E) H2O only
CO2 + H2O
158. The correct formula for sulfuric acid is ________. A) H2SO4 B) H2SO3 C) H2SO4 - D) H2SO4 - E) SO4 2-
H2SO4
180. Which of the following could be a buffer? A) NaF(aq) B) HF(aq) + NaF(aq) C) HF(aq) + H2O(l) D) NaF(aq) + H2O(l) E) NaCl(aq) + HF(aq)
HF(aq) + NaF(aq)
163. Which of the following statements correctly describes the hydronium-hydroxide balance in the given solution? A) In acids, [OH- ] is greater than [H3O + ]. B) In bases, [OH- ] = [H3O + ]. C) In neutral solutions, [H3O + ] = [H2O]. D) In bases, [OH- ] is greater than [H3O + ]. E) In bases, [OH- ] is less than [H3O + ].
In bases, [OH- ] is greater than [H3O + ].
Which of the following is not true for a competitive inhibitor? A) It occupies the active site. B) It cannot be converted to products. C) It has a structure similar to the substrate. D) Increasing the substrate concentration can reverse competitive inhibition. E) It binds to the enzyme at a site remote from the active site.
It binds to the enzyme at a site remote from the active site.
340. What tripeptide is coded for by the following mRNA sequence? UUU AGA CCA A) Phe-Pro-Arg B) Pro-Arg-Phe C) Phe-Arg-Pro D) Leu-Pro-Arg E) Phe-Thr-Pro
Phe-Arg-Pro
293. The structural formulas of amino acids are the same except for the ________. A) carboxylate group B) alpha carbon C) ammonium group D) R group E) hydrogen bonding
R group
304. The structure of collagen consists of ________. A) single α-helix strands B) double α-helix strands C) many α-helixes wound into fibrils D) a braided triple helix E) many glycoside links
a braided triple helix
217. Structural isomers are molecules that share the same formula and have ________. A) a different shape to the molecule B) the same arrangement of atoms within the molecule C) a different arrangement of atoms within the molecule D) identical boiling points E) the same shape in each molecule
a different arrangement of atoms within the molecule
286. Waxes are lipids derived from ________. A) a long-chain alcohol and a long-chain fatty acid B) glycerol and three fatty acids C) glycerol, fatty acids, phosphate, and an amino alcohol D) fatty acids, phosphate, and an amino alcohol E) steroids
a long-chain alcohol and a long-chain fatty acid
172. When an acid reacts with a metal like Al, the products are ________. A) water and a base B) water and a salt C) water and carbon dioxide D) a salt and carbon dioxide E) a salt and hydrogen
a salt and hydrogen
228. The compound 1-butyne contains ________. A) all single bonds B) a double bond C) a triple bond D) a ring structure E) a bromine atom
a triple bond
364. In order to enter the citric acid cycle, pyruvate is first converted to ________. A) lactate B) acetaldehyde C) citrate D) acetyl-CoA E) ethanol
acetyl-CoA
261. The odor of an amine can be neutralized with ________. A) water B) acids C) bases D) detergents E) solvents
acids
In the induced-fit model of enzyme action, the enzyme active site ________. A) stays the same shape during substrate binding B) adjusts shape to adapt to the shape of the substrate C) stays the same shape while causing a change in the shape of the substrate D) uses an inhibitor to adjust its shape for the substrate E) uses a cofactor to change the shape of a substrate
adjusts shape to adapt to the shape of the substrate
241. Three functional groups found in this compound are ________. A) alcohol, aromatic, and ether B) alcohol, aldehyde, and ether C) alcohol, ether, and ketone D) aldehyde, ether, and carboxylic acid E) cycloalkene, alcohol, and carboxylic acid
alcohol, ether, and ketone
269. A monosaccharide that contains 6 carbon atoms, one of which is in an aldehyde group, is classified as a(n) ________. A) aldopentose B) aldohexose C) ketopentose D) aldotetrose E) ketotetrose
aldohexose
257. Physiologically active nitrogen-containing compounds produced by plants are called ________. A) aromatics B) alkaloids C) esters D) polymers E) ethers
alkaloids
263. Nicotine, coniine, quinine, atropine, and morphine are all examples of ________. A) ethers B) esters C) carboxylic acids D) alkaloids E) amides
alkaloids
207. An organic compound composed of carbon and hydrogen connected only by single bonds is an ________. A) alkane B) alkene C) alkyne D) aromatic compound E) alcohol
alkane
341. Mutations are the result of ________. A) alterations in the phosphate of the DNA backbone B) exposure to water in utero C) physical trauma in the mother's childhood D) alterations in the sugar component of the DNA backbone E) alterations in the DNA base sequence
alterations in the DNA base sequence
A noncompetitive inhibitor ________. A) binds at the active site of the enzyme B) alters the three-dimensional structure of the enzyme C) increases the rate of the enzyme-catalyzed reaction D) has a structure similar to the substrate E) has its effect reversed by adding more substrate
alters the three-dimensional structure of the enzyme
266. What kind of compound is urea? A) ester B) acid C) amide D) ketone E) amine
amide
297. The peptide bonds that link amino acids in a protein are ________. A) ester bonds B) ether bonds C) amide bonds D) glycosidic bonds E) sulfide bonds
amide bonds
256. What functional group is always found in alkaloids (such as caffeine, nicotine, and digitalis)? A) amide B) acid C) ether D) amine E) ester
amine
264. Amides are derivatives of ________ and ________. A) amines, esters B) amines, carboxylic acids C) alkanes, amines D) carboxylic acids, alcohols E) alcohols, carboxylic acids
amines, carboxylic acids
262. In what form are amine-containing drugs often administered? A) free base B) sodium salt C) ammonium salt D) water solution E) oil solution
ammonium salt
354. An enzyme that can facilitate the breakdown of amylose into smaller units is ________. A) glucose phosphatase B) alcohol dehydrogenase C) amylase D) lactase E) maltase
amylase
156. According to the Arrhenius concept, if HNO3 were dissolved in water, it would act as ________. A) a base B) an acid C) a source of hydroxide ions D) a source of H- ions E) a proton acceptor
an acid
171. In a neutralization reaction ________. A) two acids react to form water B) water and a salt react to form an acid and a base C) an acid and a salt react to form water and a base D) a base and a salt react to form water and an acid E) an acid and a base react to form a salt and water
an acid and a base react to form a salt and water
250. What is the product of the reaction of an alcohol and a carboxylic acid when heated together under acidic conditions? A) an ether B) an ester C) a salt D) a ketone E) an aldehyde
an ester
346. The reactions by which complex molecules are built up for the body's use are ________. A) transmission reactions B) catabolic reactions C) anabolic reactions D) glucogenesis E) gluconeogenesis
anabolic reactions
308. The names of many enzymes can be recognized by the suffix ________. A) ate B) ite C) ose D) ine E) ase
ase
294. The side chain for histidine is classified as a ________ side chain. A) basic B) neutral C) acidic D) nonpolar E) polar
basic
247. Which carboxylic acid in the list below is an aromatic carboxylic acid? A) acetic acid B) benzoic acid C) butyric acid D) benzene E) citric acid
benzoic acid
309. The presence of enzymes to catalyze bioreactions in our bodies allows ________. A) us to eat non-nutritious substances without consequence B) the activation energy of a reaction to be raised C) the rate of a desired chemical reaction to slow down D) bioreactions to occur under extreme conditions of temperature and pH E) bioreactions to take place under mild conditions
bioreactions to take place under mild conditions
326. The two new DNA molecules formed in replication ________. A) are different from the original DNA B) both contain only two new daughter DNA strands C) both contain only the parent DNA strands D) contain one parent and one daughter strand E) are identical, with one containing both parent strands, and the other containing both daughter
both contain only the parent DNA strands
244. Which of the following compounds would give a positive Tollens' test? A) methanol B) acetone C) diethyl ether D) phenol E) butanal
butanal
252. When this compound undergoes hydrolysis in acid, what product(s) are obtained? A) butanoic acid and ethanol B) butanoic acid C) ethanol D) ethanoic acid and butanol E) butanoic acid and butanol
butanoic acid and ethanol
242. The carbonyl group consists of ________. A) carbon-oxygen-hydrogen attached by single bonds B) carbon and oxygen attached by a single bond C) carbon and oxygen attached by a double bond D) carbon and oxygen attached by a triple bond E) a carbon-oxygen-carbon attached by single bonds
carbon and oxygen attached by a double bond
283. A polyunsaturated fatty acid contains more than one ________. A) carboxyl group B) hydroxyl group C) carbonyl group D) long carbon chain E) carbon-carbon double bond
carbon-carbon double bond
245. The functional group in acetic acid is called the ________. A) hydroxyl group B) aldehyde group C) carbonyl group D) carboxyl group E) ester group
carboxyl group
345. The reactions by which complex molecules are broken down into simpler ones for the body's use are ________. A) transmission reactions B) catabolic reactions C) anabolic reactions D) glucogenesis E) gluconeogenesis
catabolic reactions
291. Sucrase, the protein that facilitates the hydrolysis of sucrose, would be classified as a ________ protein. A) transport B) hormonal C) catalytic D) structural E) contractile
catalytic
307. The general function of an enzyme in the body is to ________. A) catalyze chemical reactions B) maintain a neutral pH C) act as a reactant in carbohydrate storage D) maintain homeostasis E) eliminate waste products from the blood
catalyze chemical reactions
335. Codons are base pair sequences that ________. A) signal the start of DNA synthesis B) signal the end of DNA synthesis C) code for amino acids D) signal the start of RNA synthesis E) code for one or more bases in mRNA
code for amino acids
370. In mammals, the ammonium ion produced in oxidative deamination is ________. A) excreted in the feces B) stored in the liver C) converted to uric acid, which is excreted in the urine D) converted to urea, which is excreted in the urine E) converted to uric acid, which is excreted by the liver
converted to urea, which is excreted in the urine
289. The steroid hormone that increases the blood glucose and glycogen levels from fatty acids and amino acids is ________. A) aldosterone B) progesterone C) cortisone D) estrogen E) prednisone
cortisone
237. What is the common name of this compound? A) cyclopentyl ethyl ether B) cyclopentyl ethyl ketone C) 1-cyclopropyl-1-ethylalcohol D) ethylcyclopentanol E) 3-cyclopentylethanol
cyclopentyl ethyl ether
321. Which of the following can be found in DNA? A) ribose B) GMP C) uracil D) deoxyadenosine E) FMN
deoxyadenosine
254. The common name of this compound is ________. A) ethylamine B) ethylethylamine C) diethylamine D) dimethylamine E) ethylmethylamine
diethylamine
349. The first stage of catabolism is ________. A) the citric acid cycle B) production of pyruvate C) production of acetyl-CoA D) buildup of macromolecules from monomers E) digestion of large molecules
digestion of large molecules
279. Maltose can be classified as a(n) ________. A) disaccharide B) polysaccharide C) ketose D) pentose E) tetrasaccharide
disaccharide
305. Heavy metals denature proteins by ________. A) releasing amino acids B) disrupting hydrophobic interactions C) changing the pH of the protein solution D) changing the temperature of the protein solution E) disrupting disulfide bonds
disrupting disulfide bonds
234. A phenol has an -OH group bonded to a(n) ________. A) singly substituted or unsubstituted carbon B) disubstituted carbon C) trisubstituted carbon D) carbon. in a benzene ring E) tetrasubstituted carbon
disubstituted carbon
300. In insulin, two peptide chains are held together in a single unit by ________. A) disulfide bridges B) hydrogen bonds C) salt bridges D) a prosthetic group E) a β-pleated sheet
disulfide bridges
223. An alkene is an organic compound that contains a ________ bond. A) single B) double C) triple D) aromatic E) hydrogen
double
357. The digestion of fats begins when the fat globules are ________. A) emulsified by bile salts B) attacked by protease enzymes to form smaller fat globules C) converted to lipoproteins for greater solubility D) hydrolyzed to glucose and amino acids E) hydrolyzed to glycerol and fatty acids
emulsified by bile salts
249. Many of the fragrances of flowers and the flavors of fruits are due to ________. A) ethers B) carboxylic acids C) esters D) amines E) amides
esters
220. What is the name for a two-carbon saturated alkyl group? A) methyl B) ethyl C) propyl D) butyl E) pentyl
ethyl
The formation of an enzyme-substrate complex is the ________ step in enzyme action. A) first B) second C) third D) fourth E) last
first
185. Which of the following types of radiation has the highest energy? A) a-particles B) b-particles C) g-rays D) visible light E) All of these have the same energy
g-rays
277. When glucose is reduced the product is ________. A) glucitol B) gluconic acid C) sucrose D) galactose E) maltose
glucitol
276. When glucose is oxidized the product is ________. A) glucitol B) gluconic acid C) sucrose D) galactose E) maltose
gluconic acid
365. The citric acid cycle is used in the oxidation of ________. A) glucose only B) glucose and fatty acids only C) fatty acids only D) glucose, fatty acids, and proteins E) proteins only
glucose, fatty acids, and proteins
288. The main lipid components in cellular membranes are ________. A) glycerolphospholipids B) fatty acids C) steroids D) triacylglycerols E) waxes
glycerolphospholipids
278. In a disaccharide, two monosaccharides are joined by what kind of bond? A) double B) anomeric C) alcohol D) glycosidic E) rotational
glycosidic
213. In a condensed structural formula, each carbon atom is ________. A) shown with all individual atoms and bonds drawn B) shown with only the other carbon atoms C) grouped with its bonded hydrogen atoms D) not explicitly shown E) written in lowercase letters
grouped with its bonded hydrogen atoms
211. A cycloalkane ________. A) has two fewer carbon atoms than the corresponding alkane B) has two fewer hydrogen atoms than the corresponding alkane C) contains -CH3 groups joined by single bonds D) always contains a three carbon ring E) has no hydrogen atoms
has two fewer hydrogen atoms than the corresponding alkane
301. The attractive forces that are important in the secondary structure of a protein are ________. A) hydrogen bonds B) hydrophobic interactions C) disulfide bonds D) salt bridges E) peptide bonds
hydrogen bonds
325. The bonds that link the base pairs in the DNA double helix are ________. A) ionic bonds B) peptide bonds C) hydrogen bonds D) hydrophobic interactions E) ester bonds
hydrogen bonds
268. A monosaccharide that consists of 5 carbon atoms, one of which is in a ketone group, is classified as a(n) ________. A) aldotetrose B) aldopentose C) aldohexose D) ketotetrose E) ketopentose
ketopentose
285. Compared to saturated fatty acids, unsaturated fatty acids have ________. A) longer carbon chains B) shorter carbon chains C) higher melting points D) lower melting points E) greater intermolecular attraction
lower melting points
The function of the enzyme-substrate complex is to provide an alternative reaction pathway that ________. A) lowers the energy of the products B) lowers the energy of the substrate C) changes the concentration of the substrate D) lowers the activation energy for the reaction E) changes the possible product formed
lowers the activation energy for the reaction
358. The enzymes that break down triacylglycerols into fatty acids and glycerol are called ________. A) lyases B) aconitases C) lipases D) hydrolases E) oxidoreductases
lyases
330. Which of the following types of RNA carries the genetic information from DNA in the nucleus to the ribosomes? A) mRNA B) histone RNA C) rRNA D) tRNA E) sRNA
mRNA
337. During protein synthesis, the codon for an amino acid is found on ________. A) DNA B) rRNA C) tRNA D) mRNA E) sRNA
mRNA
336. The codon is found on ________, and the anticodon is found on ________. A) mRNA, tRNA B) tRNA, mRNA C) rRNA, tRNA D) ribosomes, tRNA E) mRNA, rRNA
mRNA, tRNA
271. Fructose does not undergo hydrolysis because it is a ________. A) aldose B) hexose C) reducing sugar D) monosaccharide E) disaccharide
monosaccharide
273. Galactose is a ________. A) monosaccharide B) disaccharide C) trisaccharide D) polysaccharide E) phosphosaccharide
monosaccharide
284. The skeletal structure of palmitoleic acid is shown below. Palmitoleic acid is a ________. A) saturated fatty acid B) polyunsaturated fatty acid C) monounsaturated fatty acid D) strong acid E) monosaturated fatty acid
monounsaturated fatty acid
353. Digestion of carbohydrates begins in the ________. A) mouth B) stomach C) pancreas D) small intestine E) large intestine
mouth
292. In the ionized form of an amino acid, the carboxylic acid end is ________. A) positively charged B) negatively charged C) neutral D) soluble in a nonpolar solvent E) attached to an amine
negatively charged
170. An acid and base react to form a salt and water in a(n) ________ reaction. A) ionization B) dissociation C) oxidation D) neutralization E) reduction
neutralization
200. What does the ? represent in the bombardment equation of nitrogen-14? 14 7N + ? → 14 6C + 1 1H A) alpha particle B) beta particle C) gamma ray D) proton E) neutron
neutron
295. The side chain for valine is classified as a ________ side chain. A) basic B) neutral C) acidic D) nonpolar E) polar
nonpolar
317. A ________ consists of a nitrogen-containing base and a sugar. A) nucleoside B) base pair C) nucleotide D) complementary base E) pyrimidine
nucleoside
318. A ________ consists of a nitrogen-containing base, a sugar, and a phosphate group. A) nucleoside B) base pair C) nucleotide D) complementary base E) purine
nucleotide
243. An aldehyde forms a carboxylic acid by ________. A) oxidation B) reduction C) hydrolysis D) neutralization E) hydrogenation
oxidation
270. The breakdown of glucose to chemical energy for the cells to do work is an example of ________. A) oxidation B) respiration C) reduction D) anabolism E) mutarotation
oxidation
303. What kinds of interactions are not part of tertiary protein structure? A) peptide bonds B) disulfide bonds C) hydrophilic interactions D) salt bridges E) hydrophobic interactions
peptide bonds
299. In the peptide Ala-Try-Gly-Phe, the C-terminus is ________. A) alanine B) phenylalanine C) tryptophan D) aspartate E) glycine
phenylalanine
322. The interactions that link the nucleotides in a nucleic acid are ________. A) ionic bonds B) peptide bonds C) hydrogen bonds D) hydrophobic bonds E) phosphodiester bonds
phosphodiester bonds
280. Amylose is a ________. A) monosaccharide B) disaccharide C) trisaccharide D) polysaccharide E) phosphosaccharide
polysaccharide
239. The skeletal formula represents what type of alcohol? A) primary B) secondary C) tertiary D) quaternary E) none
primary
255. The compound CH3-CH2-NH2 is classified as a ________. A) primary amine B) secondary amine C) tertiary amine D) quaternary amine E) hydrated amine
primary amine
258. Aniline is a(n) ________. A) primary aromatic amine B) secondary aromatic amine C) heterocyclic amine D) aliphatic amine E) tertiary amine
primary aromatic amine
362. The overall process of glycolysis ________. A) requires oxygen B) uses up 4 ATP molecules C) requires acetyl-CoA D) is an anabolic pathway E) produces 2 ATP molecules
produces 2 ATP molecules
221. What is the name for a three-carbon saturated alkyl group? A) methyl B) ethyl C) propyl D) butyl E) pentyl
propyl
339. Translation is the process whereby ________. A) DNA is synthesized from DNA B) DNA is synthesized from mRNA C) protein is synthesized from DNA D) protein is synthesized from mRNA E) mRNA is synthesized from DNA
protein is synthesized from mRNA
361. In the process of glycolysis, glucose is converted to ________. A) pyruvate B) citrate C) sucrose D) oxaloacetate E) ribose
pyruvate
363. Under anaerobic conditions, lactate is produced from ________. A) acetyl-CoA B) pyruvate C) ATP D) carbon dioxide E) NA
pyruvate
347. Overall, catabolic reactions ________. A) release energy B) take in energy C) occur mainly in the liver D) occur outside the cell membrane E) take place in the nucleus of the cell
release energy
327. What is the process in which the DNA double helix unfolds, and each strand serves as a template for the synthesis of a new strand? A) transcription B) complementation C) translation D) replication E) restriction
replication
348. Anabolic reactions are reactions that ________. A) use oxidation but not reduction B) break down large molecules into smaller ones C) take place in the mitochondria D) require energy E) give off energy
require energy
181. What is the name of the medical condition of an asthmatic patient with a blood pH of 7.30? A) respiratory acidosis B) respiratory alkalosis C) metabolic acidosis D) metabolic alkalosis E) diabetes mellitus
respiratory acidosis
182. When hyperventilation (rapid breathing) causes a patient to exhale large amounts of , the blood pH rises in a condition called ________. A) metabolic acidosis B) metabolic alkalosis C) respiratory acidosis D) respiratory alkalosis E) pulmonary distress
respiratory alkalosis
320. Which of the following will not be found in DNA? A) adenine B) thymine C) guanine D) cytosine E) ribose
ribose
356. The digestion of fats begins in the ________. A) mouth B) stomach C) small intestine D) gall bladder E) large intestine
small intestine
248. The neutralization of formic acid by NaOH produces ________. A) sodium formate as the only product B) formate ion and hydronium ion C) sodium formaldehyde D) methyl alcohol E) sodium formate and H2O
sodium formaldehyde
355. The digestion of protein begins in the ________. A) mouth B) stomach C) small intestine D) large intestine E) pancreas
stomach
290. Collagen, a protein found in tendons and cartilage, would be classified as a ________ protein. A) catalytic B) structural C) transport D) storage E) hormone
structural
216. Compounds that have the same molecular formula but different arrangements of atoms are called ________. A) structural isomers B) isotopes C) indicators D) isozymes E) isometrics
structural isomers
344. A mutation which occurs when one base in a DNA sequence replaces another, is called a ________. A) deletion mutation B) insertion mutation C) substitution mutation D) translocation mutation E) viral mutation
substitution mutation
235. Thiols have structures similar to alcohols except that they contain ________. A) three alcohol groups B) more than one carbon C) sulfur in place of oxygen in the functional group D) lithium in place of oxygen in the functional group E) nitrogen in place of oxygen in the functional group
sulfur in place of oxygen in the functional group
240. The skeletal formula represents what type of alcohol? A) primary B) secondary C) tertiary D) quaternary E) none
tertiary
179. In a buffer system of HF and its salt, NaF, ________. A) the HF neutralizes added acid B) the HF neutralizes added base C) the HF is not necessary D) the Fneutralizes added H2O E) the Fneutralizes added base
the HF neutralizes added base
233. The compound CH3CH2-SH is in the organic family known as ________. A) ethers B) thiols C) alcohols D) sulfides E) amino acids
thiols
212. The simplest cycloalkane has ________. A) one carbon atom B) two carbon atoms C) three carbon atoms D) four carbon atoms E) five carbon atoms
three carbon atoms
224. An alkyne is an organic compound that contains a ________ bond. A) single B) double C) triple D) aromatic E) hydrogen
triple
302. Which of the following is a secondary protein structure? A) α-helix B) Ser-Met-Ala-Gly-Ile C) disulfide bond D) salt bridges E) hydrophobic interactions
α-helix
281. Cellulose is not digestible by humans because it contains glucose units linked by ________- glycosidic bonds. A) α-1,2 B) α-1,4 C) α-1,6 D) β-1,2 E) β-1,4
β-1,4
368. The series of reactions that produce energy by hydrolyzing fats to units of acetyl-CoA is called ________. A) transamination B) β-oxidation C) hydration D) hydrolysis E) β-reduction
β-oxidation
